|
|
| | 1-Boc-3-bromomethylpiperidine Basic information |
| Product Name: | 1-Boc-3-bromomethylpiperidine | | Synonyms: | TERT-BUTYL 3-(BROMOMETHYL)PIPERIDINE-1-CARBOXYLATE;1-N-BOC-3-BROMOMETHYLPIPERIDINE;3-(Bromomethyl)piperidine, N-BOC protected;N-Boc-3-(bromomethyl)piperidine;1-Boc-3-broMoMethylpiperi...;tert-Butyl 3-(bromomethyl)piperidine-1-carboxylate, 3-(Bromomethyl)-1-(tert-butoxycarbonyl)piperidine;3-(bromomethyl)-1-piperidinecarboxylic acid tert-butyl ester;1-Boc-3-(BromomethyL | | CAS: | 193629-39-9 | | MF: | C11H20BrNO2 | | MW: | 278.19 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 193629-39-9.mol |  |
| | 1-Boc-3-bromomethylpiperidine Chemical Properties |
| Boiling point | 318.3±15.0 °C(Predicted) | | density | 1.270 | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | -2.03±0.40(Predicted) | | form | liquid | | color | Light yellow | | InChI | 1S/C11H20BrNO2/c1-11(2,3)15-10(14)13-6-4-5-9(7-12)8-13/h9H,4-8H2,1-3H3 | | InChIKey | MGGZYACWICDRRD-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCCC(CBr)C1 |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 1-Boc-3-bromomethylpiperidine Usage And Synthesis |
| | 1-Boc-3-bromomethylpiperidine Preparation Products And Raw materials |
|