| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | (+)-Cyclosativene Basic information |
| Product Name: | (+)-Cyclosativene | | Synonyms: | 1,2,4-Metheno-1H-indene, octahydro-1,7a-dimethyl-5-(1-methylethyl)-, [1S-(1alpha,2alpha,3abeta,4alpha,5alpha,7abeta,8S*)]-;(1S,2S,3aR,4R,5S,7aS,8R)-Octahydro-1,7a-dimethyl-5-isopropyl-1,2,4-metheno-1H-indene;[1S,3aβ,8R,(+)]-Octahydro-1,7aβ-dimethyl-5α-isopropyl-1,2α,4α-metheno-1H-indene;(+)-Cyclosativene 99%;1,2,4-Metheno-1H-indene, octahydro-1,7a-dimethyl-5-(1-methylethyl)-, (1S,2S,3aR,4R,5S,7aS,8R)-;(+)-CYCLOSATIVENE ISO 9001：2015 REACH;(+)-Cyclosativene in isooctane;(+)-Cyclosativene | | CAS: | 22469-52-9 | | MF: | C15H24 | | MW: | 204.36 | | EINECS: | | | Product Categories: | Alkanes;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 22469-52-9.mol |  |
| | (+)-Cyclosativene Chemical Properties |
| Boiling point | 87 °C/10 mmHg (lit.) | | density | 0.929 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.488(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | liquid | | Optical Rotation | [α]20/D +78°, neat | | BRN | 6791339 | | InChI | 1S/C15H24/c1-8(2)9-5-6-14(3)10-7-11-13(12(9)10)15(11,14)4/h8-13H,5-7H2,1-4H3/t9-,10+,11-,12+,13-,14-,15-/m0/s1 | | InChIKey | XBWACJDEQIZTPR-YIZGKYRPSA-N | | SMILES | [H][C@@]12C[C@@]3([H])[C@@]4([H])[C@]1([H])[C@@H](CC[C@]2(C)[C@@]34C)C(C)C | | LogP | 5.864 (est) |
| WGK Germany | 3 | | F | 10-23 | | Storage Class | 12 - Non Combustible Liquids |
| | (+)-Cyclosativene Usage And Synthesis |
| | (+)-Cyclosativene Preparation Products And Raw materials |
|