CIS-DECAHYDRONAPHTHALENE manufacturers
|
| | CIS-DECAHYDRONAPHTHALENE Basic information |
| Product Name: | CIS-DECAHYDRONAPHTHALENE | | Synonyms: | c-Decahydronaphthalene;c-Decalin;cis-Bicyclo[4.4.0]Decane;cis-decahydronaphthalenen;cis-Decahydronapthalene;cis-naphthalen;decahydronaphthalene(cis-);decahydronaphthalene, cis | | CAS: | 493-01-6 | | MF: | C10H18 | | MW: | 138.25 | | EINECS: | 207-770-9 | | Product Categories: | | | Mol File: | 493-01-6.mol |  |
| | CIS-DECAHYDRONAPHTHALENE Chemical Properties |
| Melting point | −43 °C(lit.) | | Boiling point | 193 °C(lit.) | | density | 0.897 g/mL at 25 °C(lit.) | | vapor density | 4.76 (vs air) | | vapor pressure | 42 mm Hg ( 92 °C) | | refractive index | n20/D 1.481(lit.) | | Fp | 137 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | explosive limit | 0.7-4.9%, 100°F | | Water Solubility | 8.92g/L(300 ºC) | | Merck | 14,2846 | | BRN | 1900822 | | Dielectric constant | 2.2（20℃） | | Stability: | Stable. Incompatible with oxidizing agents. May form explosive peroxides. Heat and light accelerate peroxide formation. | | InChI | 1S/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ | | InChIKey | NNBZCPXTIHJBJL-AOOOYVTPSA-N | | SMILES | [H][C@]12CCCC[C@@]1([H])CCCC2 | | Surface tension | 32.1mN/m at 298.15K | | CAS DataBase Reference | 493-01-6(CAS DataBase Reference) | | EPA Substance Registry System | cis-Decahydronaphthalene (493-01-6) |
| Hazard Codes | Xn,N,C | | Risk Statements | 20-36/37/38-65-51/53-34 | | Safety Statements | 26-36-62-61-45-36/37/39 | | RIDADR | UN 1147 3/PG 3 | | WGK Germany | 3 | | RTECS | QJ3150000 | | Autoignition Temperature | 482 °F | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29021990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Inhalation
Aquatic Chronic 2
Asp. Tox. 1
Eye Irrit. 2
Flam. Liq. 3
Skin Corr. 1C |
| | CIS-DECAHYDRONAPHTHALENE Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | cis-Decahydronaphthalene is used as a quantitation standard in the determination of sesquiterpanes. | | Definition | ChEBI: Decalin is an ortho-fused bicyclic hydrocarbon that is the decahydro- derivative of naphthalene. It has a role as a solvent. | | Purification Methods | Purification methods described for the mixed isomers are applicable here. The individual isomers can be separated by very efficient fractional distillation, followed by fractional crystallisation by partial freezing. The cis-isomer reacts preferentially with AlCl3 and can be removed from the trans-isomer by stirring the mixture with a limited amount of AlCl3 for 48hours at room temperature, filtering and distilling. [Seyer & Walker J Am Chem Soc 60 2125 1938, Baker & Schuetz J Am Chem Soc 69 1250 1949.] A very pure authentic sample is best obtained by synthesis from cis-1,2-bis-chloroethylcyclohexane [Whitesides & Gutowski J Org Chem 41 2882 1976, Beilstein 5 IV 310.] |
| | CIS-DECAHYDRONAPHTHALENE Preparation Products And Raw materials |
|