| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
N-Methyl-beta-carboline-3-carboxamide manufacturers
- FG 7142
-
- $58.00
-
2026-09-10
- CAS:78538-74-6
- Purity: 98.81%
- Supply Ability: 10g
- FG 7142
-
- $58.00
-
2026-05-11
- CAS:78538-74-6
- Purity: 98.81%
- Supply Ability: 10g
|
| | N-Methyl-beta-carboline-3-carboxamide Basic information | | Description |
| Product Name: | N-Methyl-beta-carboline-3-carboxamide | | Synonyms: | 4-b)indole-3-carboxamide,n-methyl-9h-pyrido(;n-methyl-9h-pyrido(3,4-b)indole-3-carboxamide;FG 7142;B-carboline-3-carboxylic acid N-*methylamide;N-METHYL-B-CARBOLINE-3-CARBOXAMIDE (FG-7 142);beta-carboline-3-carboxylic acid N-methylamide;β-Carboline-3-carboxylic acid N-methylamide;β-CCA methylamide, FG-7142, N-Methyl-β-carboline-3-carboxamide | | CAS: | 78538-74-6 | | MF: | C13H11N3O | | MW: | 225.25 | | EINECS: | | | Product Categories: | GABA/Glycine receptor | | Mol File: | 78538-74-6.mol |  |
| | N-Methyl-beta-carboline-3-carboxamide Chemical Properties |
| Melting point | 269-270° | | Boiling point | 576.3±30.0 °C(Predicted) | | density | 1.328±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | ethanol: 1 mg/mL | | pka | 13.44±0.46(Predicted) | | form | A crystalline solid | | color | light tan | | InChI | 1S/C13H11N3O/c1-14-13(17)11-6-9-8-4-2-3-5-10(8)16-12(9)7-15-11/h2-7,16H,1H3,(H,14,17) | | InChIKey | QMCOPDWHWYSJSA-UHFFFAOYSA-N | | SMILES | CNC(=O)c1cc2c(cn1)[nH]c3ccccc23 |
| WGK Germany | 3 | | RTECS | UU9780100 | | Storage Class | 11 - Combustible Solids |
| | N-Methyl-beta-carboline-3-carboxamide Usage And Synthesis |
| Description | FG 7142 (ZK 39106; LSU-65) is a nonselective benzodiazepine inverse agonist with high affinity (Ki= 91 nM) for the α1 subunit-containing GABAA receptor. FG 7142 also modulates GABA-induced chloride flux (EC50=137 nM) at GABAA receptors expressing the α1 subunit. FG 7142 increases tyrosine hydroxylation and leads to upregulation of β-adrenergic receptors in mouse cerebral cortex. | | Uses | FG 7142 is a benzodiazepine inverse agonist anxiogenic compound. | | Definition | ChEBI: N-methyl-9H-pyrido[3,4-b]indole-3-carboxamide is a member of beta-carbolines. | | Biological Activity | Inverse agonist and anxiogenic agent. Increases tyrosine hydroxylation and causes upregulation of β -adrenoceptors in mouse cerebral cortex. | | Biochem/physiol Actions | Benzodiazepine inverse receptor agonist; potent anxiogenic agent. | | storage | Store at RT |
| | N-Methyl-beta-carboline-3-carboxamide Preparation Products And Raw materials |
|