|
|
| | 5ALPHA-ANDROST-16-EN-3ALPHA-OL Basic information |
| Product Name: | 5ALPHA-ANDROST-16-EN-3ALPHA-OL | | Synonyms: | (3.alpha.,5.alpha.)-Androst-16-en-3-ol;(3alpha,5alpha)-androst-16-en-3-o;5alpha-Androst-16-en-3a-ol;OCCLESTEROL;3ALPHA-HYDROXY-5ALPHA-ANDROST-16-ENE;5ALPHA-ANDROST-16-EN-3ALPHA-OL;5A-ANDROST-16-EN-3ALPHA-OL;5a-androst-16-en-3a-ol | | CAS: | 1153-51-1 | | MF: | C19H30O | | MW: | 274.44 | | EINECS: | 214-573-1 | | Product Categories: | Steroids | | Mol File: | 1153-51-1.mol |  |
| | 5ALPHA-ANDROST-16-EN-3ALPHA-OL Chemical Properties |
| Melting point | 140-141 °C(lit.) | | Boiling point | 374.1±42.0 °C(Predicted) | | density | 1.037±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 20 mg/ml,DMSO: 10 mg/ml,Ethanol: 30 mg/ml | | form | A crystalline solid | | pka | 14.84±0.60(Predicted) | | Odor | at 100.00 %. animal musk natural | | Odor Type | musk | | biological source | synthetic (organic) | | Merck | 13,644 | | InChI | 1S/C19H30O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,13-17,20H,4-8,10-12H2,1-2H3/t13-,14+,15-,16-,17-,18-,19-/m0/s1 | | InChIKey | KRVXMNNRSSQZJP-PHFHYRSDSA-N | | SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](O)CC[C@]34C)[C@@H]1CC=C2 | | LogP | 6.030 (est) | | CAS DataBase Reference | 1153-51-1(CAS DataBase Reference) | | EPA Substance Registry System | Androst-16-en-3-ol, (3.alpha.,5.alpha.)- (1153-51-1) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 5ALPHA-ANDROST-16-EN-3ALPHA-OL Usage And Synthesis |
| Uses | 5ALPHA-ANDROST-16-EN-3ALPHA-OL is an alcohol derivative and can be used as a pharmaceutical intermediate. | | Uses | 5-α-androst-16-en-3-α-ol (androstenol) is an androgen believed to act as a pheromone. Androstenol has been used in a study to develop a combined gas chromatography/thermal conversion/isotope ratio mass spectrometry (GC/TC/IRMS) method for D/H ratio determination of endogenous urinary steroids. | | Definition | ChEBI: 5alpha-androst-16-en-3alpha-ol is a 3alpha-sterol. It has a role as a pheromone. It derives from a hydride of a 5alpha-androst-16-ene. | | Biochem/physiol Actions | 5alpha-androst-16-en-3alpha-ol (androstenol), is an androgen believed to act as a pheromone. |
| | 5ALPHA-ANDROST-16-EN-3ALPHA-OL Preparation Products And Raw materials |
|