| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-(S)-3-amino-4-(2-cyano-phenyl)-butyric acid Basic information |
| | Boc-(S)-3-amino-4-(2-cyano-phenyl)-butyric acid Chemical Properties |
| Boiling point | 496.8±40.0 °C(Predicted) | | density | 1.19 | | pka | 4.37±0.10(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChI | 1S/C16H20N2O4/c1-16(2,3)22-15(21)18-13(9-14(19)20)8-11-6-4-5-7-12(11)10-17/h4-7,13H,8-9H2,1-3H3,(H,18,21)(H,19,20)/t13-/m0/s1 | | InChIKey | HBMUTHPYXNFHBB-ZDUSSCGKSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1ccccc1C#N | | CAS DataBase Reference | 270065-83-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Boc-(S)-3-amino-4-(2-cyano-phenyl)-butyric acid Usage And Synthesis |
| | Boc-(S)-3-amino-4-(2-cyano-phenyl)-butyric acid Preparation Products And Raw materials |
|