|
|
| | (-)-5-Caffeoyl quinic acid Basic information |
| Product Name: | (-)-5-Caffeoyl quinic acid | | Synonyms: | (1S)-1β,3β,4β-Trihydroxy-5α-[(E)-3-(3,4-dihydroxyphenyl)acryloyloxy]cyclohexane-1-carboxylic acid;(1S)-5α-[[(E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1β,3β,4β-trihydroxycyclohexanecarboxylic acid;(E)-3-(3,4-Dihydroxyphenyl)acrylic acid [(1R)-2α,3α,5-trihydroxy-5β-carboxycyclohexane-1β-yl] ester;1,4α,5α-Trihydroxy-3β-(3,4-dihydroxy-trans-cinnamoyloxy)cyclohexane-1β-carboxylic acid;1,4α,5α-Trihydroxy-3β-[(E)-3-(3,4-dihydroxyphenyl)propenoyloxy]cyclohexane-1β-carboxylic acid;Cyclohexanecarboxylic acid, 3-[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,4,5-trihydroxy-, (1S,3R,4R,5R)-;(-)-5-Caffeoyl quinic acid;trans-Chlorogenic acid | | CAS: | 202650-88-2 | | MF: | C16H18O9 | | MW: | 354.31 | | EINECS: | | | Product Categories: | | | Mol File: | 202650-88-2.mol |  |
| | (-)-5-Caffeoyl quinic acid Chemical Properties |
| Boiling point | 665.0±55.0 °C(Predicted) | | density | 1.65±0.1 g/cm3(Predicted) | | pka | 3.90±0.50(Predicted) | | InChIKey | CWVRJTMFETXNAD-JUHZACGLSA-N | | SMILES | [C@]1(O)(C(O)=O)C[C@@H](O)[C@@H](O)[C@H](OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C1 |
| | (-)-5-Caffeoyl quinic acid Usage And Synthesis |
| Definition | ChEBI: Chlorogenic acid is a cinnamate ester obtained by formal condensation of the carboxy group of trans-caffeic acid with the 3-hydroxy group of quinic acid. It is an intermediate metabolite in the biosynthesis of lignin. It has a role as a plant metabolite and a food component. It is a cinnamate ester and a tannin. It is functionally related to a (-)-quinic acid and a trans-caffeic acid. It is a conjugate acid of a chlorogenate. |
| | (-)-5-Caffeoyl quinic acid Preparation Products And Raw materials |
|