2,4,5-Trifluorobenzenesulfonyl chloride manufacturers
|
| | 2,4,5-Trifluorobenzenesulfonyl chloride Basic information |
| Product Name: | 2,4,5-Trifluorobenzenesulfonyl chloride | | Synonyms: | 2,4,5-TRIFLUOROBENZENESULPHONYL CHLORIDE;2,4,5-TRIFLUOROBENZENESULFONYL CHLORIDE;BUTTPARK 23\07-75;Benzenesulfonyl chloride, 2,4,5-trifluoro- (9CI);2,4,5-Trifluo;2,4,5-trifluorobenzenesulfonyl chlorid;2,4,5-Trifluorobenze;2,4,5-trifluorobenzene-1-sulfonyl chloride | | CAS: | 220227-21-4 | | MF: | C6H2ClF3O2S | | MW: | 230.59 | | EINECS: | 642-467-9 | | Product Categories: | SULFONYLHALIDE;Fluorobenzene;Aromatic Halides (substituted);Benzenesulfonyl chloride | | Mol File: | 220227-21-4.mol |  |
| | 2,4,5-Trifluorobenzenesulfonyl chloride Chemical Properties |
| Boiling point | 240.1±35.0 °C(Predicted) | | density | 1,657 g/cm3 | | refractive index | 1.503 | | Fp | >100°(212°F) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | Sensitive | Moisture Sensitive | | InChI | 1S/C6H2ClF3O2S/c7-13(11,12)6-2-4(9)3(8)1-5(6)10/h1-2H | | InChIKey | STCZWXXRRTWRSK-UHFFFAOYSA-N | | SMILES | Fc1cc(F)c(cc1F)S(Cl)(=O)=O | | CAS DataBase Reference | 220227-21-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39 | | RIDADR | 3265 | | WGK Germany | WGK 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2904990090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 2,4,5-Trifluorobenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | off-white solid |
| | 2,4,5-Trifluorobenzenesulfonyl chloride Preparation Products And Raw materials |
|