| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | DIMETHYL[2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINE Basic information |
| Product Name: | DIMETHYL[2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINE | | Synonyms: | 2-(N,N-DIMETHYLAMINO)PHENYLBORONIC ACID, PINACOL ESTER;2-(Dimethylamino)phenylboronic acid pinacol ester;2-dioxaborolan-2-yl)phenyl]aMine;DiMethyl[2-(4;N,N-diMethyl-2-(tetraMethyl-1,3,2-dioxaborolan-2-yl)aniline;2-(Dimethylamino)phenylboronic acid pinacol ester 97%;N,N-Dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;N,N-diMethyl-2-(tetraMethyl-1,3,2- | | CAS: | 832114-08-6 | | MF: | C14H22BNO2 | | MW: | 247.14 | | EINECS: | | | Product Categories: | Heterocyclic Compounds;Aryl Boronate Esters;Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Organometallic Reagents | | Mol File: | 832114-08-6.mol | ![DIMETHYL[2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINE Structure](CAS/GIF/832114-08-6.gif) |
| | DIMETHYL[2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINE Chemical Properties |
| Melting point | 50-54℃ | | Boiling point | 338.9±25.0 °C(Predicted) | | density | 1.01±0.1 g/cm3(Predicted) | | Fp | >110°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 4.98±0.18(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C14H22BNO2/c1-13(2)14(3,4)18-15(17-13)11-9-7-8-10-12(11)16(5)6/h7-10H,1-6H3 | | InChIKey | MHFTXKKNHASNEZ-UHFFFAOYSA-N | | SMILES | CN(C)c1ccccc1B2OC(C)(C)C(C)(C)O2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DIMETHYL[2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINE Usage And Synthesis |
| Uses | 2-Dimethylaminophenylboronic acid, pinacol ester |
| | DIMETHYL[2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINE Preparation Products And Raw materials |
|