|
|
| | 4-(N,N-Dimethylamino)phenylboronic acid, pinacol ester Basic information |
| Product Name: | 4-(N,N-Dimethylamino)phenylboronic acid, pinacol ester | | Synonyms: | N,N-DIMETHYL[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINE;DIMETHYL[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINE;2-[4-(Dimethylamino)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4-(Dimethylamino)phenylboronic Acid Pinacol Ester;N,N-DiMethyl-4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)anil;2-[4-(Dimethylamino)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
4-(Dimethylamino)phenylboronic Acid Pinacol Ester;N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline>Benzenamine, N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | | CAS: | 171364-78-6 | | MF: | C14H22BNO2 | | MW: | 247.14 | | EINECS: | | | Product Categories: | | | Mol File: | 171364-78-6.mol |  |
| | 4-(N,N-Dimethylamino)phenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 122-123°C | | Boiling point | 347.1±25.0 °C(Predicted) | | density | 1.01±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 4.66±0.24(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C14H22BNO2/c1-13(2)14(3,4)18-15(17-13)11-7-9-12(10-8-11)16(5)6/h7-10H,1-6H3 | | InChIKey | DGMLJJIUOFKPKB-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37/39-36/37 | | RIDADR | UN2811 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 4-(N,N-Dimethylamino)phenylboronic acid, pinacol ester Usage And Synthesis |
| | 4-(N,N-Dimethylamino)phenylboronic acid, pinacol ester Preparation Products And Raw materials |
|