5-Bromopyrazolo[1,5-a]pyrimidine manufacturers
|
| | 5-Bromopyrazolo[1,5-a]pyrimidine Basic information | | Uses |
| | 5-Bromopyrazolo[1,5-a]pyrimidine Chemical Properties |
| density | 1.89±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -0.50±0.30(Predicted) | | Appearance | Light brown to yellow Solid | | InChI | InChI=1S/C6H4BrN3/c7-5-2-4-10-6(9-5)1-3-8-10/h1-4H | | InChIKey | DIYTVASYDOBYQA-UHFFFAOYSA-N | | SMILES | C12=CC=NN1C=CC(Br)=N2 |
| | 5-Bromopyrazolo[1,5-a]pyrimidine Usage And Synthesis |
| Uses | 5-Bromopyrazolo[1,5-A]pyrimidine heterocyclic compounds have long attracted much attention due to their wide range of applications in medicine, pesticides, and new materials, making them an important class of organic compounds. 5-Bromopyrazolo[1,5-A]pyrimidine is a novel bromine-containing heterocyclic compound with both pyrazole and pyrimidine rings in its structure. | | Application |
5-Bromopyrazolo[1,5-A]pyrimidine has high reactivity and is widely used in medicine, pesticides and new materials.
| | Hazard | 5-Bromopyrazolo[1,5-A]pyrimidine is harmful if swallowed, it causes skin irritation and serious eye irritation.
| | Synthesis | 5-Bromopyrazolo[1,5-A]pyrimidine can be synthesized by reacting pyrazolo[1,5-a]pyridine with bromine in ethanol and NaOH solution.
|
| | 5-Bromopyrazolo[1,5-a]pyrimidine Preparation Products And Raw materials |
|