|
|
| | (R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one (Z)-2-butenedioate Basic information |
| Product Name: | (R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one (Z)-2-butenedioate | | Synonyms: | (R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one (Z)-2-butenedioate;PNU 95666;Sumanirole maleate;U 95666E(Sumanirole maleate);U95666E;PNU 95666E;(5R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one maleate;(R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one maleate | | CAS: | 179386-44-8 | | MF: | C15H17N3O5 | | MW: | 319.32 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 179386-44-8.mol | ![(R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one (Z)-2-butenedioate Structure](CAS2/GIF/179386-44-8.gif) |
| | (R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one (Z)-2-butenedioate Chemical Properties |
| Melting point | 200-208°C (dec.) | | storage temp. | -20°C | | solubility | H2O: soluble10mg/mL, clear | | form | powder | | color | white to beige | | Optical Rotation | [α]/D -22 to -32°, c = 1 in H2O | | Water Solubility | H2O: 10mg/mL, clear | | InChI | 1S/C11H13N3O.C4H4O4/c1-12-8-5-7-3-2-4-9-10(7)14(6-8)11(15)13-9;5-3(6)1-2-4(7)8/h2-4,8,12H,5-6H2,1H3,(H,13,15);1-2H,(H,5,6)(H,7,8)/b;2-1-/t8-;/m1./s1 | | InChIKey | VOJRMYBBPKNLLI-ORHWHDKWSA-N | | SMILES | O=C1N(C[C@H](NC)C2)C3=C2C=CC=C3N1.O=C(O)/C=C\C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one (Z)-2-butenedioate Usage And Synthesis |
| Uses | Sumanirole is a high affinity D2 receptor agonist (EC50 values are between 17 and 75 nM in cell-based assays). Sumanirole displays >200-fold selectivity for the D2 receptor against other dopamine receptor subtypes (Ki values are 9.0, 1940, >2190 and >7140 for D2, D3, D4 and D1 receptors respectively). Sumanirole exhibits antiParkinsonian activity similar to Ropinirole (R641000). | | Biochem/physiol Actions | Sumanirole is a highly selective and potent dopamine D2 receptor agonist that decreased plasma prolactin levels and depressed dopamine neuron firing rates in the substantia nigra pars compacta. Sumanirole potently stimulates locomotor activity in in animal models of Parkinson′s disease. | | IC 50 | D2 Receptor | | storage | Store at -20°C |
| | (R)-5,6-Dihydro-5-(methylamino)-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one (Z)-2-butenedioate Preparation Products And Raw materials |
|