| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
MIRA-1 manufacturers
- MIRA-1
-
- $33.00
-
2026-07-27
- CAS:72835-26-8
- Purity: 99.94%
- Supply Ability: 10g
|
| Product Name: | MIRA-1 | | Synonyms: | MIRA-1;1-[(1-Oxopropoxy)methyl]-1H-pyrrole-2,5-dione;1H-Pyrrole-2,5-dione, 1-[(1-oxopropoxy)methyl]-;Ethyl 2,5-Dioxo-2,5-dihydropyrrole-1-acetate;1-[(1-Oxopropoxy)methyl]-1H-pyrrole-2;5-dihydro-1H-pyrrol-1-yl)methyl propionate;p53 Activator VIII;WRN Helicase Inhibitor | | CAS: | 72835-26-8 | | MF: | C8H9NO4 | | MW: | 183.16 | | EINECS: | | | Product Categories: | Apoptosis Inducers | | Mol File: | 72835-26-8.mol |  |
| | MIRA-1 Chemical Properties |
| Melting point | 44 °C | | Boiling point | 298.2±23.0 °C(Predicted) | | density | 1.307±0.06 g/cm3(Predicted) | | storage temp. | Store at +4°C | | solubility | Soluble to 100 mM in DMSO and to 100 mM in ethanol | | form | Powder | | pka | -2.79±0.20(Predicted) | | color | White to light yellow | | InChI | 1S/C8H9NO4/c1-2-8(12)13-5-9-6(10)3-4-7(9)11/h3-4H,2,5H2,1H3 | | InChIKey | YXEWPGYLMHXLPS-UHFFFAOYSA-N | | SMILES | N1(C(=O)C=CC1=O)COC(=O)CC |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | MIRA-1 Usage And Synthesis |
| Uses | The tumor suppressor gene, p53, is often mutated in most human cancers. MIRA-1 is a maleimide-derived molecule that can reactivate the mutant p53 leading to apoptosis in human tumor cells. In addition, the MIRA scaffold is an attractive lead for developing anticancer drugs that target mutant p53. | | storage | Store at +4°C |
| | MIRA-1 Preparation Products And Raw materials |
|