| Company Name: |
Clearsynth Canada Inc.
|
| Tel: |
+1.415.685.4395 |
| Email: |
enquiry@clearsynth.com |
| Products Intro: |
Product Name:Mebendazole D3 CAS:1173021-87-8 Package:10mg Remarks:CS-W-00054
|
- Mebendazole-D3
-
- $0.00 / 1mg
-
2026-05-11
- CAS:1173021-87-8
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | Mebendazole-d3 Basic information |
| | Mebendazole-d3 Chemical Properties |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Heated, Sonicated) | | Major Application | forensics and toxicology pharmaceutical (small molecule) | | InChI | 1S/C16H13N3O3/c1-22-16(21)19-15-17-12-8-7-11(9-13(12)18-15)14(20)10-5-3-2-4-6-10/h2-9H,1H3,(H2,17,18,19,21)/i1D3 | | InChIKey | OPXLLQIJSORQAM-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])OC(=O)Nc1nc2cc(ccc2[nH]1)C(=O)c3ccccc3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Mebendazole-d3 Usage And Synthesis |
| Uses | Labelled Mebendazole (M200500). Anthelmintic (Nematodes). | | Uses | (Mebendazole-d3) Labeled Mebendazole, intended for use as an internal standard for the quantification of Mebendazole by GC- or LC-mass spectrometry. |
| | Mebendazole-d3 Preparation Products And Raw materials |
|