| Company Name: |
ChemeGen |
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
|
| | Trimipramine-D3 maleate Basic information |
| Product Name: | Trimipramine-D3 maleate | | Synonyms: | Trimipramine-D3 maleate;Trimipramine-D3 maleate solution;[2H3]-Trimipramine maleate;Trimipramine-D3 maleate solution;Trimipramine-D3 Maleate 0.1 mg/ml in Methanol (as free base);Trimipramine-D3.maleate, 1mg/ml in Methanol (as free base);(±)-Trimipramine-[D3] Maleate(N-Methyl-D3) (Standard) | | CAS: | 1185245-93-5 | | MF: | C24H27D3N2O4 | | MW: | 413.524485334 | | EINECS: | 200-659-6 | | Product Categories: | | | Mol File: | 1185245-93-5.mol |  |
| | Trimipramine-D3 maleate Chemical Properties |
| Fp | 9℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Pale Grey | | Major Application | clinical testing | | InChI | 1S/C20H26N2.C4H4O4/c1-16(14-21(2)3)15-22-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)22;5-3(6)1-2-4(7)8/h4-11,16H,12-15H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/i2D3; | | InChIKey | YDGHCKHAXOUQOS-QWPULOJDSA-N | | SMILES | O=C(O)/C=C\C(O)=O.CC(CN(C)C([2H])([2H])[2H])CN1C2=CC=CC=C2CCC3=C1C=CC=C3 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | Trimipramine-D3 maleate Usage And Synthesis |
| Uses | Antidepressant; serotonin transport blocker that also blocks norepinephrine uptake. |
| | Trimipramine-D3 maleate Preparation Products And Raw materials |
|