|
|
| | (RS)-4-(3-MethylaMino-1-thiophen-2-yl-propyl)-naphthalen-1-ol Basic information |
| Product Name: | (RS)-4-(3-MethylaMino-1-thiophen-2-yl-propyl)-naphthalen-1-ol | | Synonyms: | (RS)-4-(3-MethylaMino-1-thiophen-2-yl-propyl)-naphthalen-1-ol;4-[3-(Methylamino)-1-(2-thienyl)propyl]-1-naphthalenol;Duloxetine Phenolic IMpurity (PHL);Duloxetine EP IMpurity C;4-(3-(Methylamino)-1-(thiophen-2-yl)propyl)naphthalen-1-ol;Duloxetine metabolite Para-Naphthol Duloxetine;(RS)-4-(3-MethylaMino-1-thiophen-2-yl-propyl)-phthalen-1-ol;Duloxetine hydrochloride impurity F | | CAS: | 949095-98-1 | | MF: | C18H19NOS | | MW: | 297.41 | | EINECS: | | | Product Categories: | | | Mol File: | 949095-98-1.mol |  |
| | (RS)-4-(3-MethylaMino-1-thiophen-2-yl-propyl)-naphthalen-1-ol Chemical Properties |
| Melting point | >150°C (dec.) | | Boiling point | 497.2±45.0 °C(Predicted) | | density | 1.189 | | storage temp. | -20°C Freezer | | solubility | DMSO (Sparingly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 9.42±0.40(Predicted) | | color | White to Pale Orange | | InChI | InChI=1S/C18H19NOS/c1-19-11-10-16(18-7-4-12-21-18)14-8-9-17(20)15-6-3-2-5-13(14)15/h2-9,12,16,19-20H,10-11H2,1H3 | | InChIKey | OJXMJLCWKLPCHB-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(C=CC=C2)=C(C(C2SC=CC=2)CCNC)C=C1 |
| | (RS)-4-(3-MethylaMino-1-thiophen-2-yl-propyl)-naphthalen-1-ol Usage And Synthesis |
| Uses | Para-Naphthol Duloxetine is an impurity of Duloxetine (D721000), an antidepressant and a dual serotonin and norepinephrine reuptake inhibitor (SNRI) (1,2). Exhibits linear pharmacokinetics in mice and is not associated in any drastic changes of blood pressure or heart rate (3). |
| | (RS)-4-(3-MethylaMino-1-thiophen-2-yl-propyl)-naphthalen-1-ol Preparation Products And Raw materials |
|