| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Hydrazinobenzoic acid methyl ester hydrochloride Basic information |
| Product Name: | 4-Hydrazinobenzoic acid methyl ester hydrochloride | | Synonyms: | AURORA 1803;Benzoic acid, 4-hydrazino-, Methyl ester, Monohydrochloride;Methyl 4-hydrazinylbenzoate hydrochloride;methyl 4-hydrazinobenzoate hydrochloride;Benzoic acid,4-hydrazinyl-, methyl ester, hydrochloride (1:1);Dilarozil (Methylhydrazine Hydrochloride);4-Hydrazinobenzoic acid methyl ester hydrochloride | | CAS: | 6296-89-5 | | MF: | C8H11ClN2O2 | | MW: | 202.64 | | EINECS: | | | Product Categories: | | | Mol File: | 6296-89-5.mol |  |
| | 4-Hydrazinobenzoic acid methyl ester hydrochloride Chemical Properties |
| Melting point | 205-207 °C | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C8H10N2O2.ClH/c1-12-8(11)6-2-4-7(10-9)5-3-6;/h2-5,10H,9H2,1H3;1H | | InChIKey | MXSGRGCOQOKOEH-UHFFFAOYSA-N | | SMILES | C1(C(=O)OC)C=CC(NN)=CC=1.Cl |
| | 4-Hydrazinobenzoic acid methyl ester hydrochloride Usage And Synthesis |
| Uses | Methyl 4-hydrazinylbenzoate HCl | | Synthesis | General procedure for the synthesis of methyl 4-hydrazinylbenzoate hydrochloride from 2-hydrazinylbenzoic acid: 4M dioxane solution of hydrogen chloride (100 mL, 399.60 mmol) was slowly added to a solution of 2-hydrazinylbenzoic acid (15.2 g, 99.90 mmol) in methanol (200 mL). The reaction mixture was stirred at 90 °C for 5 hours. Upon completion of the reaction, it was cooled to 20 °C and the resulting precipitate was collected by filtration, washed with ether (100 mL) and subsequently dried under vacuum to afford the target product methyl 4-hydrazinobenzoate hydrochloride (16.50 g, 82% yield) as a milky white crystalline solid. Mass spectrometry analysis (ESI-) showed m/z (M-H)- = 165; high performance liquid chromatography (HPLC) retention time was 1.12 min. 1H NMR (400.13 MHz, DMSO-d6) δ 3.81 (3H, s, OCH3), 6.99-7.02 (2H, m, Ar-H), 7.86-7.90 (2H, m, Ar- H), 8.98 (1H, s, NH), 10.47 (3H, s, NH3+). | | References | [1] Patent: WO2008/99145, 2008, A1. Location in patent: Page/Page column 155-156
[2] Patent: WO2008/99145, 2008, A1. Location in patent: Page/Page column 156 |
| | 4-Hydrazinobenzoic acid methyl ester hydrochloride Preparation Products And Raw materials |
|