|
|
| | 2-CHLORO-4-METHYL-THIAZOLE Basic information |
| Product Name: | 2-CHLORO-4-METHYL-THIAZOLE | | Synonyms: | 2-CHLORO-4-METHYL-THIAZOLE;2-CHLORO-4-METHYL-1,3-THIAZOLE;2-BROMO-4-METHYLTHIAZOLE ,97%;Thiazole, 2-chloro-4-Methyl-;2-Chloro-4-methyl-1,3-thiazol;4-Methyl-2-chlorothiazole;SKL605;2-chloro-4-methyl-1,3-thiazole - [C3517] | | CAS: | 26847-01-8 | | MF: | C4H4ClNS | | MW: | 133.6 | | EINECS: | 248-046-2 | | Product Categories: | | | Mol File: | 26847-01-8.mol |  |
| | 2-CHLORO-4-METHYL-THIAZOLE Chemical Properties |
| Boiling point | 203℃ | | density | 1.331 | | Fp | 76℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 1.36±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C4H4ClNS/c1-3-2-7-4(5)6-3/h2H,1H3 | | InChIKey | SYDUUJIIXIOTQT-UHFFFAOYSA-N | | SMILES | S1C=C(C)N=C1Cl |
| | 2-CHLORO-4-METHYL-THIAZOLE Usage And Synthesis |
| Uses | 2-Chloro-4-methylthiazole is a useful research chemical, a nitrification inhibitor. |
| | 2-CHLORO-4-METHYL-THIAZOLE Preparation Products And Raw materials |
|