| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 3,3-Dichloro-1-(4-nitrophenyl)piperidin-2-one Basic information | | Physical Form |
| Product Name: | 3,3-Dichloro-1-(4-nitrophenyl)piperidin-2-one | | Synonyms: | 3,3-Dichloro-1-(4-nitrophenyl)-2-piperidinone;3,3-dichloro-1-(4-nitrophenyl)piperidin-2-one;3,3-dichloro-1-(4-nitrophenyl)piperidin-2-one
3,3-dichloro-1-(4-nitrophenyl)piperidin-2-one;2-Piperidinone, 3,3-dichloro-1-(4-nitrophenyl)-;Apixaban Impurity 60;Apixaban Impurity 65;3,3-dichloro-1-(4-nitrophenyl)2-2-piperidinone;2-Piperidinone, 3,3-dichloro-1-(4-nitrophenyl)-,881386-01-2 | | CAS: | 881386-01-2 | | MF: | C11H10Cl2N2O3 | | MW: | 289.11 | | EINECS: | 813-183-4 | | Product Categories: | | | Mol File: | 881386-01-2.mol |  |
| | 3,3-Dichloro-1-(4-nitrophenyl)piperidin-2-one Chemical Properties |
| Boiling point | 520.2±50.0 °C(Predicted) | | density | 1.50 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) | | pka | -7.38±0.40(Predicted) | | form | Solid | | color | Light Yellow to Yellow | | InChI | InChI=1S/C11H10Cl2N2O3/c12-11(13)6-1-7-14(10(11)16)8-2-4-9(5-3-8)15(17)18/h2-5H,1,6-7H2 | | InChIKey | KKVYXBZVPRSWHE-UHFFFAOYSA-N | | SMILES | N1(C2=CC=C([N+]([O-])=O)C=C2)CCCC(Cl)(Cl)C1=O |
| | 3,3-Dichloro-1-(4-nitrophenyl)piperidin-2-one Usage And Synthesis |
| Physical Form | Light Yellow to Yellow Solid | | Description | 3, 3-dichloro-1 -(4-nitrophenyl) -2-piperidinone is an important pharmaceutical intermediate, as it can be used to prepare apixaban derivatives. Apixaban is a small molecular selective FXa inhibitor of pyrazole derivatives. Similar to Rivaroxaban, apixaban has two binding sites to Factor Xa, where 4-methoxyphenyl in the apixaban structure partially binds the S1 pocket of Factor Xa and aryllactam partially binds the S4 pocket of Factor Xa. | | Uses | 3,3-Dichloro-1-(4-nitrophenyl)piperidin-2-one is a reagent used in the preparation of novel tetrahydropyrazolopyridone derivatives. Used in the preparation of anti-coagulants. |
| | 3,3-Dichloro-1-(4-nitrophenyl)piperidin-2-one Preparation Products And Raw materials |
|