| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 1-O-Acetyl-3,5-bis-(4-chlorobenzoyl)-2-deoxy-D-ribose Basic information |
| Product Name: | 1-O-Acetyl-3,5-bis-(4-chlorobenzoyl)-2-deoxy-D-ribose | | Synonyms: | 1-O-Acetyl-3,5-bis-(4-chlorobenzoyl)-2-deoxy-D-ribose;1-Acetate 3,5-Bis(4-chlorobenzoate)-2-deoxy-D-erythro-pentofuranose;2-Deoxy-D-erythro-pentofuranose 1-acetate 3,5-bis(4-chlorobenzoate);Decitabine USP RC A;1-O-Acetyl-3,5-bis-(4-chlorobenzoyl)-2-deoxy-D;Decitabine USP Related Compound A;1-O-Acetyl-3,5-di-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranose;2- deoxy -D- erythro-furapentose 1- acetate 3,5- bis (4- chlorobenzoate) | | CAS: | 1207459-15-1 | | MF: | C21H18Cl2O7 | | MW: | 453.27 | | EINECS: | 200-001-2 | | Product Categories: | | | Mol File: | 1207459-15-1.mol |  |
| | 1-O-Acetyl-3,5-bis-(4-chlorobenzoyl)-2-deoxy-D-ribose Chemical Properties |
| Melting point | >89°C (dec.) | | Boiling point | 545.4±50.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C21H18Cl2O7/c1-12(24)28-19-10-17(30-21(26)14-4-8-16(23)9-5-14)18(29-19)11-27-20(25)13-2-6-15(22)7-3-13/h2-9,17-19H,10-11H2,1H3/t17-,18+,19/m0/s1 | | InChIKey | XHRJNOXRTTZFEQ-PAMZHZACSA-N | | SMILES | C1(OC(=O)C)O[C@H](COC(=O)C2=CC=C(Cl)C=C2)[C@@H](OC(=O)C2=CC=C(Cl)C=C2)C1 |
| WGK Germany | WGK 3 | | HS Code | 2940000080 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 1-O-Acetyl-3,5-bis-(4-chlorobenzoyl)-2-deoxy-D-ribose Usage And Synthesis |
| Chemical Properties | Class white powder | | Uses | 1-O-Acetyl-3,5-bis(4-chlorobenzoyl)-2-deoxy-D-ribose is an intermediate of Decitabine (5-Aza-2’deoxy Cytidine) (A796950). |
| | 1-O-Acetyl-3,5-bis-(4-chlorobenzoyl)-2-deoxy-D-ribose Preparation Products And Raw materials |
|