4,6-dichloro-3-Methylpyridazine manufacturers
|
| | 4,6-dichloro-3-Methylpyridazine Basic information |
| | 4,6-dichloro-3-Methylpyridazine Chemical Properties |
| Boiling point | 295.1±35.0 °C(Predicted) | | density | 1.404±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 0.02±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H4Cl2N2/c1-3-4(6)2-5(7)9-8-3/h2H,1H3 | | InChIKey | SWLRTVHQASOVRZ-UHFFFAOYSA-N | | SMILES | C1(C)=NN=C(Cl)C=C1Cl |
| | 4,6-dichloro-3-Methylpyridazine Usage And Synthesis |
| Uses | 4,6-Dichloro-3-methylpyridazine is a reagent in the preparation of URAT1 inhibitors which are used in the treatment of uric acid related disorders. |
| | 4,6-dichloro-3-Methylpyridazine Preparation Products And Raw materials |
|