|
|
| | 3,4,6-Trichloropyridazine Basic information |
| Product Name: | 3,4,6-Trichloropyridazine | | Synonyms: | 3,4,6-Trichloro-1,2-diazine;3,4,6-TRICHLOROPYRIDAZINE;3-METHYL-2-BENZOXAZOLINONE,PLANT STANDARD;3,4,6-TrichL;6-Trichloropyridazine;Pyridazine, 3,4,6-trichloro-;3,4,6-Trichloropyridazine ISO 9001：2015 REACH | | CAS: | 6082-66-2 | | MF: | C4HCl3N2 | | MW: | 183.42 | | EINECS: | 629-902-8 | | Product Categories: | alkyl chloride | | Mol File: | 6082-66-2.mol |  |
| | 3,4,6-Trichloropyridazine Chemical Properties |
| Melting point | 55.0 to 59.0 °C | | Boiling point | 98°C/43mmHg(lit.) | | density | 1.641±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | -2.72±0.10(Predicted) | | color | White to Light yellow to Light orange | | λmax | 305nm(EtOH)(lit.) | | InChI | InChI=1S/C4HCl3N2/c5-2-1-3(6)8-9-4(2)7/h1H | | InChIKey | LJDQXQOPXOLCHL-UHFFFAOYSA-N | | SMILES | C1(Cl)=NN=C(Cl)C=C1Cl |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 3,4,6-Trichloropyridazine Usage And Synthesis |
| Uses | 3,4,6-Trichloropyridazine was used to study chloropyridazine derivatives as human rhinovirus capsid-binding inhibitors. | | Materials Uses | 3,4,6-Trichloropyridazine is a kind of new liquid crystal industrial raw material. | | Synthesis | The general procedure for the synthesis of 3,4,6-trichloropyridazine from 3,6-dichloropyridazine is as follows: 44 g of 3,6-dichloropyridazine and 22 g of aluminum trichloride were mixed and heated to 140°C. The mixture was then heated to 140°C for 4 hours. At this temperature, 10.6 liters of chlorine gas were slowly passed over a period of 4 hours. Upon completion of the reaction, the reaction mixture was cooled and extracted with toluene. The extract was subsequently washed with 10% sodium chloride solution and finally the product was purified by distillation to collect a fraction with a boiling point of 127-129 °C. Finally 44.1 g of 3,4,6-trichloropyridazine was obtained. | | References | [1] Patent: EP1900735, 2008, A1. Location in patent: Page/Page column 9
[2] Patent: US2010/305102, 2010, A1. Location in patent: Page/Page column 17
[3] Patent: US2012/28932, 2012, A1
[4] Patent: US2013/237527, 2013, A1. Location in patent: Paragraph 0236; 0237 |
| | 3,4,6-Trichloropyridazine Preparation Products And Raw materials |
| Raw materials | Pyridazine, 6-bromo-3,4-dichloro--->Pyridazine, 3,6-dione, 4-bromo-1,2-dihydro--->4-Bromo-3,6-dichloropyridazine-->3,6-Dichloropyridazine | | Preparation Products | 3,6-Dichloro-4-methoxypyridazine-->3,6-Dichloro-N-methyl-4-pyridazinamine |
|