| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1-Bromo-2-butanone manufacturers
- 1-BROMO-2-BUTANONE
-
- $1.00
-
2026-03-20
- CAS:816-40-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
|
| | 1-Bromo-2-butanone Basic information |
| Product Name: | 1-Bromo-2-butanone | | Synonyms: | 1-bromo-2-butanon;1-bromo-butan-2-one;1-BroMo-2-butanone, 88% [stabilized], 88%;1-Bromo-2-butanone, technical, 85%, stabilized;(BROMOMETHYL)ETHYL KETONE;Brommethylethylketon;TL 819;tl819 | | CAS: | 816-40-0 | | MF: | C4H7BrO | | MW: | 151 | | EINECS: | 212-431-3 | | Product Categories: | Halogen compounds | | Mol File: | 816-40-0.mol |  |
| | 1-Bromo-2-butanone Chemical Properties |
| Boiling point | 105 °C150 mm Hg(lit.) | | density | 1.479 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.465(lit.) | | Fp | 155 °F | | storage temp. | Keep Cold | | form | Liquid | | Specific Gravity | 1.479 | | color | Colorless to light yellow | | Sensitive | Lachrymatory | | BRN | 741894 | | InChI | InChI=1S/C4H7BrO/c1-2-4(6)3-5/h2-3H2,1H3 | | InChIKey | CCXQVBSQUQCEEO-UHFFFAOYSA-N | | SMILES | C(Br)C(=O)CC | | CAS DataBase Reference | 816-40-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi,F | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-27-36/37/39 | | RIDADR | 1693 | | WGK Germany | 3 | | RTECS | EL7000000 | | Hazard Note | Harmful/Irritant/Lachrymatory | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29147000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-Bromo-2-butanone Usage And Synthesis |
| Chemical Properties | colorless to light yellow liquid | | Uses | 1-Bromo-2-butanone (bromomethyl ethyl ketone) was used as a potential regulatory site-directed reagent for the residue C221 on pyruvate decarboxylase. It was also used as a reagent for aromatic bromination with sodium hydride in DMSO and in a microwave-assisted preparation of fused heterocycles. | | Synthesis | Using methyl 3-oxopentanoate as the starting material, the key intermediate is obtained via chlorination and dealkylation reactions with a yield exceeding 70%. Subsequently, bromination yields 1-bromo-2-butanone with an overall yield exceeding 50%. |
| | 1-Bromo-2-butanone Preparation Products And Raw materials |
|