| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | Diethyl 3-Nitrobenzylphosphonate Basic information | | Application |
| Product Name: | Diethyl 3-Nitrobenzylphosphonate | | Synonyms: | Diethyl 3-Nitrobenzylphosphonate;Diethyl 3-Nitrobenzylphosphonateonate;1-(diethoxyphosphorylmethyl)-3-nitrobenzene;Phosphonic acid, P-[(3-nitrophenyl)methyl]-, diethyl ester;Diethyl P-[(3-nitrophenyl)methyl]phosphonate;PHOSPHONIC ACID, [(3-NITROPHENYL)METHYL]-, DIETHYL ESTER;3-nitrobenzyl phosphate diethyl ester | | CAS: | 104097-04-3 | | MF: | C11H16NO5P | | MW: | 273.22 | | EINECS: | | | Product Categories: | | | Mol File: | 104097-04-3.mol |  |
| | Diethyl 3-Nitrobenzylphosphonate Chemical Properties |
| Boiling point | 173 °C(Press: 0.3 Torr) | | density | 1.239±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Light yellow to yellow Liquid | | InChI | InChI=1S/C11H16NO5P/c1-3-16-18(15,17-4-2)9-10-6-5-7-11(8-10)12(13)14/h5-8H,3-4,9H2,1-2H3 | | InChIKey | QNHAEKQJZUMZFT-UHFFFAOYSA-N | | SMILES | P(CC1=CC=CC([N+]([O-])=O)=C1)(=O)(OCC)OCC |
| | Diethyl 3-Nitrobenzylphosphonate Usage And Synthesis |
| Application | Diethyl 3-nitrobenzylphosphonate can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical production processes. |
| | Diethyl 3-Nitrobenzylphosphonate Preparation Products And Raw materials |
|