α-Tocopherol-[D6] (Vitamin E-[D6]) manufacturers
- α-Vitamin E-D6
-
- $392.00
-
2026-04-20
- CAS:113892-08-3
- Purity:
- Supply Ability: 10g
|
| | α-Tocopherol-[D6] (Vitamin E-[D6]) Basic information |
| Product Name: | α-Tocopherol-[D6] (Vitamin E-[D6]) | | Synonyms: | α-Tocopherol-[D6] (Vitamin E-[D6]);(±)-α-Tocopherol-D6 (Vitamin E-D6) solution;(2R)-2,8-dimethyl-5,7-bis(trideuteriomethyl)-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol;VITAMIN E (ALPHA-TOCOPHEROL) (5-METHYL-D3,7-METHYL-D3, 98%);(2R)-α-Tocopherol-d6 (5,7-di(methyl-d3));(±)-ALPHA-TOCOPHEROL (VITAMIN E) (D6, 98%) 500 UG/ML IN METHANOL;α-Tocopherol-d6;alpha-Tocopherol (phenyl-5,7-dimethyl-d6) | | CAS: | 113892-08-3 | | MF: | C29H50O2 | | MW: | 430.72 | | EINECS: | | | Product Categories: | | | Mol File: | 113892-08-3.mol | ![α-Tocopherol-[D6] (Vitamin E-[D6]) Structure](CAS/20180808/GIF/113892-08-3.gif) |
| | α-Tocopherol-[D6] (Vitamin E-[D6]) Chemical Properties |
| Melting point | -97.99°C | | density | 0.963 g/mL at 25 °C | | Fp | 9℃ | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Ethanol (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil to Thick Oil | | color | Pale Yellow to Brown | | Boiling point | 200-220°C/1 mmHg(lit.) | | Stability: | Light Sensitive | | InChI | InChI=1/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3/t21-,22-,29-/s3 | | InChIKey | GVJHHUAWPYXKBD-SBFBBCEENA-N | | SMILES | CC1C(=C(O)C(C([H])([H])[H])=C2CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)OC=12)C([H])([H])[H] |&1:13,18,23,r| | | CAS Number Unlabeled | 59-02-9 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | α-Tocopherol-[D6] (Vitamin E-[D6]) Usage And Synthesis |
| Description | α-Tocopherol (phenyl-5,7-dimethyl-d6) is the most bioactive form of fat-soluble vitamin E, which has a stable deuterium label, can be used as an internal standard for chromatographic methods with a tandem mass spectrometric detector. | | Uses | Labelled α-Tocopherol (T526125). Most bioactive of the naturally occurring forms of Vitamin E. Richest sources are green vegetables, grains, and oils, particularly palm, safflower and sunflower oils. |
| | α-Tocopherol-[D6] (Vitamin E-[D6]) Preparation Products And Raw materials |
|