| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | Fmoc-10-ADC-OH Basic information |
| Product Name: | Fmoc-10-ADC-OH | | Synonyms: | N-(9-FLUORENYLMETHYLOXYCARBONYL)-10-AMINO-DECANOIC ACID;N-(9-FLUOROENYLMETHYLOXYCARBONYL)-10-AMINO-DECANOIC ACID;10-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]decanoic acid;10-(Fmoc-amino)decanoic acid;Decanoic acid, 10-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-;Fmoc-10-ADC-OH | | CAS: | 143688-82-8 | | MF: | C25H31NO4 | | MW: | 409.52 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 143688-82-8.mol |  |
| | Fmoc-10-ADC-OH Chemical Properties |
| Boiling point | 611.7±28.0 °C(Predicted) | | density | 1.144±0.06 g/cm3(Predicted) | | pka | 4.78±0.10(Predicted) | | InChI | InChI=1S/C25H31NO4/c27-24(28)16-6-4-2-1-3-5-11-17-26-25(29)30-18-23-21-14-9-7-12-19(21)20-13-8-10-15-22(20)23/h7-10,12-15,23H,1-6,11,16-18H2,(H,26,29)(H,27,28) | | InChIKey | VRQUPGNWTJGCBX-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCCCNC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | Fmoc-10-ADC-OH Usage And Synthesis |
| | Fmoc-10-ADC-OH Preparation Products And Raw materials |
|