Fmoc-11-aminoundecanoic acid manufacturers
|
| | Fmoc-11-aminoundecanoic acid Basic information |
| Product Name: | Fmoc-11-aminoundecanoic acid | | Synonyms: | NALPHA-9-Fluorenylmethoxycarbonyl-11-aminoundecanoic acid;FMOC-11-AMINOUNDECYLIC ACID;FMOC-11-AUN-OH;FMOC-NH-(CH2)10-COOH;11-(FMOC-AMINO)UNDECANOIC ACID;N-(9-FLUORENYLMETHOXYCARBONYL)-11-AMINOUNDECANOIC ACID;N-(9-FLUORENYLMETHOXYCARBONYL)-11-AMINOUNDECYLIC ACID;N-(9-FLUORENYLMETHYLOXYCARBONYL)-11-AMINO-UNDECANOIC ACID | | CAS: | 88574-07-6 | | MF: | C26H33NO4 | | MW: | 423.54 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 88574-07-6.mol |  |
| | Fmoc-11-aminoundecanoic acid Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | color | white | | BRN | 4887890 | | Major Application | peptide synthesis | | InChI | 1S/C26H33NO4/c28-25(29)17-7-5-3-1-2-4-6-12-18-27-26(30)31-19-24-22-15-10-8-13-20(22)21-14-9-11-16-23(21)24/h8-11,13-16,24H,1-7,12,17-19H2,(H,27,30)(H,28,29) | | InChIKey | IMEVDILDSCXKJW-UHFFFAOYSA-N | | SMILES | OC(=O)CCCCCCCCCCNC(=O)OCC1c2ccccc2-c3ccccc13 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Fmoc-11-aminoundecanoic acid Usage And Synthesis |
| Description | Fmoc-11-aminoundecanoic acid can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applicaitons. Fmoc-11-aminoundecanoic acid is an alkane chian with terminal Fmoc-protected amine and carboxylic acid groups. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Uses | Fmoc-11-aminoundecanoic acid can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applications. Fmoc-11-aminoundecanoic acid is an alkane chain with terminal Fmoc-protected amine and carboxylic acid groups. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-11-aminoundecanoic acid Preparation Products And Raw materials |
|