| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
1,2-Dichloroethane-d4 manufacturers
|
| | 1,2-Dichloroethane-d4 Basic information |
| Product Name: | 1,2-Dichloroethane-d4 | | Synonyms: | DEUTERO-1,2-DICHLOROETHANE;ETHYLENE-D4 DICHLORIDE;ETHYLENE-D4 CHLORIDE;1,2-DICHLOROETHANE-D4, 1000MG, NEAT;1,2 DICHLOROETHANE-D4, 1X1ML, MEOH, 2000 UG/ML;1,2-DICHLOROETHANE-D4, 99 ATOM % D;1,2-DICHLOROETHANE-D4, 99% (ISOTOPIC);Ethane-1,1,2,2-d4, 1,2-dichloro- | | CAS: | 17060-07-0 | | MF: | C2H4Cl2 | | MW: | 98.95 | | EINECS: | | | Product Categories: | 600 Series Wastewater Methods;Alpha Sort;D;DAlphabetic;DIA - DICEPA;Method 624;Volatiles/ Semivolatiles | | Mol File: | 17060-07-0.mol |  |
| | 1,2-Dichloroethane-d4 Chemical Properties |
| Melting point | −35 °C(lit.) | | Boiling point | 83 °C(lit.) | | density | 1.307 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.443(lit.) | | Fp | 60 °F | | storage temp. | room temp | | solubility | Acetone (Slightly), DMSO (Sparingly), Methanol (Slightly) | | form | Liquid | | Water Solubility | Partially miscible with water. | | Henry's Law Constant | 8.7×10-3 mol/(m3Pa) at 25℃, Hiatt (2013) | | Stability: | Volatile | | Major Application | agriculture
environmental | | InChI | InChI=1S/C2H4Cl2/c3-1-2-4/h1-2H2 | | InChIKey | WSLDOOZREJYCGB-UHFFFAOYSA-N | | SMILES | C([H])([H])(Cl)C([H])([H])Cl | | CAS DataBase Reference | 17060-07-0(CAS DataBase Reference) | | EPA Substance Registry System | 1,2-Dichloroethane-d4 (17060-07-0) | | CAS Number Unlabeled | 107-06-2 |
| Hazard Codes | F,T | | Risk Statements | 45-11-22-36/37/38-39/23/24/25-23/24/25 | | Safety Statements | 53-45-36/37-16 | | RIDADR | UN 1184 3/PG 2 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | II | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 4 Oral
Asp. Tox. 1
Carc. 1B
Eye Irrit. 2
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,2-Dichloroethane-d4 Usage And Synthesis |
| Uses | 1,2-Dichloroethane-d4 is widely used as a solvent for NMR analysis, and in the synthesis of poly(ethylene-d4 oxide) as a chain termination reagent. | | Uses | 1,2-Dichloroethane-d4 may be used:
- As a NMR solvent.
- As a surrogate standard during the analysis of volatile organic compounds (VOC) in water by gas chromatography-mass spectrometry (GC-MS).
- As a chain termination reagent in the synthesis of poly(ethylene-d4 oxide).
| | General Description | 1,2-Dichloroethane-d4 is 1,2-dichloroethane with all the hydrogen atoms replaced by deuterium. Its synthesis and structure elucidation by neutron diffraction measurements has been reported. |
| | 1,2-Dichloroethane-d4 Preparation Products And Raw materials |
|