|
|
| | Cholesteryl pelargonate Basic information |
| | Cholesteryl pelargonate Chemical Properties |
| Melting point | 74-77 °C (lit.) | | Boiling point | 360 °C | | alpha | -30 º (c=2, CHCl3 25 ºC) | | density | 0.9587 (rough estimate) | | refractive index | -24 ° (C=1, THF) | | storage temp. | Sealed in dry,Room Temperature | | form | liquid crystal | | Optical Rotation | [α]25/D 30°, c = 2 in chloroform | | Water Solubility | Soluble in Chloroform, Tetrahydrofuran(THF). Insoluble in water. | | BRN | 3179820 | | Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT SKIN CONDITIONING - HUMECTANT HUMECTANT SKIN CONDITIONING - OCCLUSIVE | | Cosmetic Ingredient Review (CIR) | Cholesteryl pelargonate (1182-66-7) | | InChIKey | WCLNGBQPTVENHV-MKQVXYPISA-N | | SMILES | CCCCCCCCC(=O)O[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(CCC4C3CC=C2C1)[C@H](C)CCCC(C)C | | LogP | 14.108 (est) | | CAS DataBase Reference | 1182-66-7(CAS DataBase Reference) | | NIST Chemistry Reference | Cholest-5-en-3-ol (3«beta»)-, nonanoate(1182-66-7) | | EPA Substance Registry System | Cholest-5-en-3-ol (3.beta.)-, nonanoate (1182-66-7) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29159000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | Cholesteryl pelargonate Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Cholesteryl nonanoate is used in hair colors, cosmetic products like lip products, lotions. It is also used in the manufature of some pleochroic dyes. It can be also used as a component of the liquid crystals used for liquid crystal displays. |
| | Cholesteryl pelargonate Preparation Products And Raw materials |
|