| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Tetradecyl Lactate
-
-
2025-06-27
- CAS:1323-03-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | Lactic acid tetradecyl ester Basic information |
| Product Name: | Lactic acid tetradecyl ester | | Synonyms: | 2-hydroxy-propanoicacitetradecylester;2-hydroxypropionic acid myristyl ester;Lactic Acid Tetradecyl Ester
Myristyl Lactate
Tetradecyl 2-Hydroxypropionate;n-Tetradecyl lactate;Propanoic acid, 2-hydroxy-, tetradecyl ester;Tetradecyllactat;2-Hydroxypropionic acid tetradecyl ester;Ceraphyl 50 | | CAS: | 1323-03-1 | | MF: | C17H34O3 | | MW: | 286.45 | | EINECS: | 215-350-1 | | Product Categories: | | | Mol File: | 1323-03-1.mol |  |
| | Lactic acid tetradecyl ester Chemical Properties |
| Melting point | 23 °C | | Boiling point | 330.0±10.0 °C(Predicted) | | density | 0.91 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.44 | | Fp | 23 °C | | storage temp. | Store at room temperature | | form | powder to lump to clear liquid | | pka | 13.05±0.20(Predicted) | | color | White or Colorless to Light yellow | | Odor | Odorless | | Water Solubility | 600μg/L at 25℃ | | Cosmetics Ingredients Functions | SKIN CONDITIONING SKIN CONDITIONING - EMOLLIENT | | Cosmetic Ingredient Review (CIR) | LACTIC ACID TETRADECYL ESTER (1323-03-1) | | InChI | InChI=1S/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-20-17(19)16(2)18/h16,18H,3-15H2,1-2H3 | | InChIKey | BORJONZPSTVSFP-UHFFFAOYSA-N | | SMILES | C(OCCCCCCCCCCCCCC)(=O)C(O)C | | LogP | 5.7 at 25℃ | | EPA Substance Registry System | Myristyl lactate (1323-03-1) |
| TSCA | TSCA listed | | HS Code | 2918.11.5100 |
| | Lactic acid tetradecyl ester Usage And Synthesis |
| Uses | myristyl lactate is a light emollient and moisturizer with good spreadability. It leaves a smooth, satiny afterfeel. Sources indicate it as being comedogenic and with a slight irritancy potential. | | Uses | Tetradecyl Lactate is a herbicide compound with improved properties. it is cosmetic compound too, used in compressing Silicones and oils. |
| | Lactic acid tetradecyl ester Preparation Products And Raw materials |
|