| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Amino-4-tert-butylphenol Basic information |
| | 2-Amino-4-tert-butylphenol Chemical Properties |
| Melting point | 160-163 °C(lit.) | | Boiling point | 293.09°C (rough estimate) | | density | 1.0203 (rough estimate) | | refractive index | 1.5290 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 9.97±0.18(Predicted) | | form | powder to crystal | | color | White to Brown | | InChI | InChI=1S/C10H15NO/c1-10(2,3)7-4-5-9(12)8(11)6-7/h4-6,12H,11H2,1-3H3 | | InChIKey | RPJUVNYXHUCRMG-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C(C)(C)C)C=C1N | | CAS DataBase Reference | 1199-46-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29222990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Amino-4-tert-butylphenol Usage And Synthesis |
| Chemical Properties | BEIGE TO BROWN CRYSTALLINE POWDER | | Uses | 2-Amino-4-tert-butylphenol can be used as a reactant to prepare:
- 4-tert-butyl-2-[(pyridylmethylene)amino]phenol intermediates, which are used to synthesize biologically important 2-(pyridyl)benzoxazole derivatives.
- Prolinamide phenols, as efficient hydrophobic organocatalysts for direct asymmetric aldol reaction aldehydes and ketones in water.
- N-(2-hydroxy-4-tert-butylphenyl)-acetamide, a key intermediate to prepare uranylsalophene derivatives which can be used as selective receptors in anion sensitive membrane sensors.
- Poly(2-amino-4-tert-butylphenol) [poly(2A-4TBP)] by electrochemical or chemical oxidative polymerization reaction.
|
| | 2-Amino-4-tert-butylphenol Preparation Products And Raw materials |
|