| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:2-Methylpropyl-d9 Alcohol
CAS:850209-54-0
Remarks:CS-C-02572
|
| Company Name: |
Combiphos (Shanghai) Biological Technology Co., Ltd.
|
| Tel: |
021-65232103 17602124823 |
| Email: |
combiphos@vip.qq.com |
| Products Intro: |
Product Name:2-(methyl-d3)propan-1,1,2,3,3,3-d6-1-ol
CAS:850209-54-0
Purity:95% HPLC Package:100 mg
250 mg
500 mg
1.0 g
5.0 g
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:2-Methylpropyl-d9 Alcohol
CAS:850209-54-0
Purity:98% Package:5g;25g;100g Remarks:Flavours and Fragrances
|
|
| | 2-METHYLPROPYL-D9 ALCOHOL Basic information |
| Product Name: | 2-METHYLPROPYL-D9 ALCOHOL | | Synonyms: | 2-METHYLPROPYL-D9 ALCOHOL;1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-1-ol;2H9]-Isobutanol;2-(methyl-d3)propan-1,1,2,3,3,3-d6-1-ol;2-Methyl-1-propan-d9-ol | | CAS: | 850209-54-0 | | MF: | C4HD9O | | MW: | 83.18 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-METHYLPROPYL-D9 ALCOHOL Chemical Properties |
| form | liquid | | InChI | 1S/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3/i1D3,2D3,3D2,4D | | InChIKey | ZXEKIIBDNHEJCQ-CBZKUFJVSA-N | | SMILES | OC([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| WGK Germany | WGK 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 2-METHYLPROPYL-D9 ALCOHOL Usage And Synthesis |
| Uses | 2-Methylpropyl alcohol-D9 is the labelled analogue of 2-Methylpropyl alcohol (I780075). Isobutyl Alcohol is a reagent used in organic reactions. It is used in the synthesis of new fluorinating reagents. It is also used in the lipase-catalyzed production of biodiesel as an energy source. |
| | 2-METHYLPROPYL-D9 ALCOHOL Preparation Products And Raw materials |
|