|
|
| | 1-PHENYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE Basic information |
| Product Name: | 1-PHENYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE | | Synonyms: | LABOTEST-BB LT00847564;1-PHENYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE;1,3,8-Triazaspiro[4.5]decan-4-one, 1-phenyl-;spirodecanone;1-PHENYL-1,3 8-TRIAZASPIRO4,5DECAN-4-ONE 95%;1-Phenyl-1,3,8-triazaspiro4,5adecan- 4-one, 95%;3-Phenylspiro[imidazolidine-4,4'-piperidine]-5-one;1-Phenyl-1,3,8-triazaspiro[4.5]decan-4-one,95% | | CAS: | 1021-25-6 | | MF: | C13H17N3O | | MW: | 231.29 | | EINECS: | 213-819-5 | | Product Categories: | Others;AntagonistsHeterocyclic Building Blocks;Dopaminergics;N-Containing;Neurotransmitters | | Mol File: | 1021-25-6.mol | ![1-PHENYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE Structure](CAS/GIF/1021-25-6.gif) |
| | 1-PHENYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE Chemical Properties |
| Melting point | 188-191 °C | | Boiling point | 373.38°C (rough estimate) | | density | 1.0744 (rough estimate) | | refractive index | 1.5700 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 15.08±0.20(Predicted) | | color | White to Pale Beige | | InChI | InChI=1S/C13H17N3O/c17-12-13(6-8-14-9-7-13)16(10-15-12)11-4-2-1-3-5-11/h1-5,14H,6-10H2,(H,15,17) | | InChIKey | HTQWGIHCFPWKAS-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2)C2(CCNCC2)C(=O)NC1 | | CAS DataBase Reference | 1021-25-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29339980 |
| | 1-PHENYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE Usage And Synthesis |
| Chemical Properties | beige to light brown powder | | Uses | 1-Phenyl-1,3,8-triazaspiro[4.5]decan-4-one is a metabolite of long acting neuroleptic agent Fluspirilene (F599800). 1-Phenyl-1,3,8-triazaspiro[4.5]decan-4-one is also a basic metabolite formed from butyrophenone type agents. |
| | 1-PHENYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE Preparation Products And Raw materials |
|