|
|
| | RS 102221 hydrochloride Basic information |
| Product Name: | RS 102221 hydrochloride | | Synonyms: | 8-[5-(2,4-Dimethoxy-5-(4-trifluoromethylphenylsulfonamido)phenyl-5-oxopentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dionehy;RS102221HCl;8-[5-(2,4-Dimethoxy-5-(4-trifluoromethylphenylsulfonamido)phenyl-5-oxopentyl]-1,3,8-triazaspiro[4.;8-[5-(2,4-Dimethoxy-5-(4-Trifluoromethylphenylsulphonamido)Phenyl-5-Oxopentyl)]-1,3,8-Triazaspiro[4.5]Decane-2,4-Dione Hydrochloride;8-[5-(2,4-DIMETHOXY-5-(4-TRIFLUOROMETHYLPHENYLSULPHONAMIDO)PHENYL-5-OXOPENTYL)]-1,3,8-TRIAZASPIRO[4.5]DECANE-2,4-DIONE HYDROCHLORIDE;N-[5-[5-(2,4-Dioxo-1,3,8-triazaspiro[4.5]dec-8-yl)-1-oxopentyl]-2,4-dimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide;RS 102221;4-dione hydrochloride hydrate | | CAS: | 185376-97-0 | | MF: | C27H31F3N4O7S | | MW: | 612.62 | | EINECS: | | | Product Categories: | | | Mol File: | 185376-97-0.mol |  |
| | RS 102221 hydrochloride Chemical Properties |
| density | 1.45 | | storage temp. | Store at RT | | solubility | DMSO: ≥20mg/mL | | form | powder | | color | white | | InChIKey | IGACJTZTAQBWKN-UHFFFAOYSA-N | | SMILES | O.Cl.COc1cc(OC)c(cc1NS(=O)(=O)c2ccc(cc2)C(F)(F)F)C(=O)CCCCN3CCC4(CC3)NC(=O)NC4=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | RS 102221 hydrochloride Usage And Synthesis |
| Uses | RS 102221 Hydrochloride is a selective 5-HT2C receptor antagonist. | | Definition | ChEBI: N-[5-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-1-oxopentyl]-2,4-dimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide is an aromatic ketone. | | Biological Activity | Potent and selective 5-HT 2C antagonist (pK i = 8.7). Displays ~ 100-fold selectivity over the 5-HT 2A and 5-HT 2B subtypes and is > 100-fold selective over other 5-HT receptors, a- and b-adrenergic and muscarinic ACh receptors. |
| | RS 102221 hydrochloride Preparation Products And Raw materials |
|