- HA15
-
- $35.00
-
2026-07-27
- CAS:1609402-14-3
- Purity: 99.86%
- Supply Ability: 10g
|
| Product Name: | HA-15 | | Synonyms: | HA-15;CS-2893;HA15;HA 15;Acetamide, N-[4-[3-[[[5-(dimethylamino)-1-naphthalenyl]sulfonyl]amino]phenyl]-2-thiazolyl]-;HA15 >=98% (HPLC);N-(4-(3-((5-(Dimethylamino)naphthalene)-1-sulfonamido)phenyl)thiazol-2-yl)acetamide;HA-15,HSP,HA 15,Inhibitor,HA15,Apoptosis,inhibit,Autophagy,Heat shock proteins;HA15, 10 mM in DMSO | | CAS: | 1609402-14-3 | | MF: | C23H22N4O3S2 | | MW: | 466.58 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 1609402-14-3.mol |  |
| | HA-15 Chemical Properties |
| density | 1.406±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:71.5(Max Conc. mg/mL);153.24(Max Conc. mM)
Ethanol:45.0(Max Conc. mg/mL);96.45(Max Conc. mM) | | form | A solid | | pka | 7.32±0.50(Predicted) | | color | Light yellow to green yellow | | InChI | 1S/C23H22N4O3S2/c1-15(28)24-23-25-20(14-31-23)16-7-4-8-17(13-16)26-32(29,30)22-12-6-9-18-19(22)10-5-11-21(18)27(2)3/h4-14,26H,1-3H3,(H,24,25,28) | | InChIKey | LBSMEKVVMYSTIH-UHFFFAOYSA-N | | SMILES | CC(NC1=NC(C2=CC=CC(NS(C3=C(C=CC=C4N(C)C)C4=CC=C3)(=O)=O)=C2)=CS1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | HA-15 Usage And Synthesis |
| Definition | ChEBI: HA15 is a sulfonamide resulting from the formal condensation of the sulfonic acid group of 5-(dimethylamino)naphthalene-1-sulfonic acid with the aniline nitrogen of 3-(2-acetamido-1,3-thiazol-4-yl)aniline. It has been reported that by triggering an endoplasmic reticulum (ER) stress response, HA15 can reduce the viability of melanoma cells without being toxic to normal cells. It has a role as an antineoplastic agent. It is a sulfonamide, a member of 1,3-thiazoles, a member of acetamides, a tertiary amino compound, an aminonaphthalene and a biaryl. | | Biological Activity | HA15 is a small molecule that specifically targets HSPA5 (Heat shock 70kDa protein 5), also known as BiP (Immunoglobulin heavy-chain-binding protein) or Grp78 (glucose-regulated protein 78). Antitumor activity in melanoma cells tested, including cells isolated from patients and cells resistant to BRAF inhibitors. | | in vitro | HA15 induces endoplasmic reticulum stress in cells in vitro, leading to cancer cell death; in melanoma cells, it overcomes its resistance to BRAF inhibitors. | | in vivo | In xenograft mouse models (bearing melanoma cells sensitive or resistant to BRAF inhibitors), HA15 was able to induce endoplasmic reticulum stress leading to cancer cell death. | | target | | Target | Value | BiP/GRP78/HSPA5
() |
|
| | HA-15 Preparation Products And Raw materials |
|