| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | DL-Glutamic-2,3,3,4,4-d5 acid Basic information |
| Product Name: | DL-Glutamic-2,3,3,4,4-d5 acid | | Synonyms: | DL-Glutamic Acid -2,3,3,4,4-D5;WHUUTDBJXJRKMK-UXXIZXEISA-N;DL-GlutaMic-d5 Acid;2-amino-2,3,3,4,4-pentadeuteriopentanedioicaci;DL-Glutamic acid-2,3,3,4,4-d5;DL-Glutamic acid (2,3,3,4,4-D?, 97%);DL-Glutamic-2,3,3,4,4-d5 acid | | CAS: | 14341-79-8 | | MF: | C5H9NO4 | | MW: | 147.13 | | EINECS: | | | Product Categories: | Amino Acids 13C, 2H, 15N;Alphabetical Listings;G-H;Stable Isotopes | | Mol File: | 14341-79-8.mol |  |
| | DL-Glutamic-2,3,3,4,4-d5 acid Chemical Properties |
| Melting point | 185 °C (dec)(lit.) | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/i1D2,2D2,3D | | InChIKey | WHUUTDBJXJRKMK-UXXIZXEISA-N | | SMILES | [2H]C([2H])(C(O)=O)C([2H])([2H])C([2H])(N)C(O)=O | | CAS Number Unlabeled | 617-65-2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | DL-Glutamic-2,3,3,4,4-d5 acid Usage And Synthesis |
| Uses | DL-Glutamic Acid-d5 is the isotope labelled analog of DL-Glutamic Acid. Glutamic Acid is non-essential amino acid. Its salt form (glutamate) is an important neurotransmitter that plays a key role in long-term potentiation and is important for learning and memory. Glutamic Acid is also a key molecule in cellular metabolism. | | Definition | ChEBI: Glutamic acid-2,3,3,4,4-d5 is a deuterated compound that is glutamic acid in which the hydrogens at positions 2, 3, 3, 4 and 4 are replaced by deuterium. It is a deuterated compound and a non-proteinogenic alpha-amino acid. |
| | DL-Glutamic-2,3,3,4,4-d5 acid Preparation Products And Raw materials |
|