4-Cyclohexylresorcinol manufacturers
- 4-CYCLOHEXYLRESORCINOL
-
- $1.50
-
2026-05-15
- CAS:2138-20-7
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 10 Tons
|
| | 4-Cyclohexylresorcinol Basic information |
| Product Name: | 4-Cyclohexylresorcinol | | Synonyms: | 1,3-Benzenediol, 4-cyclohexyl-;4-Cyclohexyl-1,3-benzenediol;4-Cyclohexyl-1,3-resorcinol;4-CYCLOHEXYLRESORCINOL 97%;4-cyclohexylbenzene-1,3-diol;SL-Whinting 977;4-Cyclohexyl-1,3-benzenedio;4-Cyclohexylresorcinol | | CAS: | 2138-20-7 | | MF: | C12H16O2 | | MW: | 192.25 | | EINECS: | 2183803 | | Product Categories: | | | Mol File: | 2138-20-7.mol |  |
| | 4-Cyclohexylresorcinol Chemical Properties |
| Melting point | 124 °C | | Boiling point | 288.25°C (rough estimate) | | density | 1.0240 (rough estimate) | | refractive index | 1.5100 (estimate) | | pka | 9.99±0.18(Predicted) | | Water Solubility | 499.8mg/L(25 ºC) | | InChI | InChI=1S/C12H16O2/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h6-9,13-14H,1-5H2 | | InChIKey | LSEHCENPUMUIKC-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C2CCCCC2)C(O)=C1 |
| | 4-Cyclohexylresorcinol Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 73, p. 2225, 1951 DOI: 10.1021/ja01149a088 |
| | 4-Cyclohexylresorcinol Preparation Products And Raw materials |
|