Fluoroglycofen-ethyl manufacturers
- fluoroglycofen-ethyl
-
- $0.00 / 25kg
-
2025-06-26
- CAS:77501-90-7
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 20tons
- Fluoroglycofen-ethyl
-
- $1.00 / 1KG
-
2020-01-03
- CAS:77501-90-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KGS
|
| | Fluoroglycofen-ethyl Basic information |
| | Fluoroglycofen-ethyl Chemical Properties |
| Melting point | 65 °C | | Boiling point | 487.7±45.0 °C(Predicted) | | density | 1.4996 (estimate) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Yellow to Light Beige | | Water Solubility | 604ug/L(temperature not stated) | | InChI | InChI=1S/C18H13ClF3NO7/c1-2-28-16(24)9-29-17(25)12-8-11(4-5-14(12)23(26)27)30-15-6-3-10(7-13(15)19)18(20,21)22/h3-8H,2,9H2,1H3 | | InChIKey | IPPAUTOBDWNELX-UHFFFAOYSA-N | | SMILES | C(OCC(OCC)=O)(=O)C1=CC(OC2=CC=C(C(F)(F)F)C=C2Cl)=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 77501-90-7(CAS DataBase Reference) | | NIST Chemistry Reference | Fluoroglycofen ethyl ester(77501-90-7) | | EPA Substance Registry System | Fluoroglycofen-ethyl (77501-90-7) |
| Hazard Codes | Xn | | Risk Statements | 22-52/53 | | Safety Statements | 61 | | RTECS | DG5643100 | | HS Code | 29189900 |
| | Fluoroglycofen-ethyl Usage And Synthesis |
| Uses | Fluoroglycofen-ethyl can be used in biological study and agricultural use of pesticide for removing root of Alternanthera philoxeroides. |
| | Fluoroglycofen-ethyl Preparation Products And Raw materials |
|