| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 7-Aminoclonazepam-d Basic information |
| Product Name: | 7-Aminoclonazepam-d | | Synonyms: | 7-Aminoclonazepam-d;7-amino-5-(2-chloro-3,4,5,6-tetradeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one;7-Aminoclonazepam-d4 (CRM);7-Aminoclonazepam-d4 (chlorophenyl-d4);7-Aminoclonazepam-D4, 1mg/ml in Acetonitrile;7-Aminoclonazepam-D4 0.1 mg/ml in Acetonitrile | | CAS: | 1215070-96-4 | | MF: | C15H12ClN3O | | MW: | 285.73 | | EINECS: | | | Product Categories: | | | Mol File: | 1215070-96-4.mol |  |
| | 7-Aminoclonazepam-d Chemical Properties |
| Fp | 2℃ | | storage temp. | -20°C | | solubility | soluble in Chloroform, Methanol | | form | A neat solid | | Major Application | clinical testing | | InChI | 1S/C15H12ClN3O/c16-12-4-2-1-3-10(12)15-11-7-9(17)5-6-13(11)19-14(20)8-18-15/h1-7H,8,17H2,(H,19,20)/i1D,2D,3D,4D | | InChIKey | HEFRPWRJTGLSSV-RHQRLBAQSA-N | | SMILES | O=C1NC2=CC=C(N)C=C2C(C3=C([2H])C([2H])=C([2H])C([2H])=C3Cl)=NC1 |
| RIDADR | UN 1648 3 / PGII | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | 7-Aminoclonazepam-d Usage And Synthesis |
| Description | 7-Aminoclonazepam-d4 (Item No. 10010670) is intended for use as an internal standard for the quantification of 7-aminoclonazepam by GC- or LC-MS. 7-Aminoclonazepam is structurally categorized as a benzodiazepine. It is the primary metabolite of clonazepam and is readily detected in human samples. This product is intended for research and forensic applications. | | Uses | A labelled major metabolite of Clonazepam (C587080). |
| | 7-Aminoclonazepam-d Preparation Products And Raw materials |
|