| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
R(+)-3-(3-hydroxyphenyl)-N-propylpiperidine hydrochloride manufacturers
|
| | R(+)-3-(3-hydroxyphenyl)-N-propylpiperidine hydrochloride Basic information |
| | R(+)-3-(3-hydroxyphenyl)-N-propylpiperidine hydrochloride Chemical Properties |
| solubility | H2O: 150 mg/mL | | form | solid | | color | white | | Water Solubility | H2O: 150mg/mL ethanol: slightly soluble | | InChI | 1S/C14H21NO.ClH/c1-2-8-15-9-4-6-13(11-15)12-5-3-7-14(16)10-12;/h3,5,7,10,13,16H,2,4,6,8-9,11H2,1H3;1H/t13-;/m0./s1 | | InChIKey | NRHUDETYKUBQJT-ZOWNYOTGSA-N | | SMILES | Cl.CCCN1CCC[C@@H](C1)c2cccc(O)c2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | R(+)-3-(3-hydroxyphenyl)-N-propylpiperidine hydrochloride Usage And Synthesis |
| Uses | R(+)-3-(3-Hydroxyphenyl)-N-propylpiperidine Hydrochloride interacts with central dopamine (DA) receptors. Agonist; Anti-psychotic. | | Biochem/physiol Actions | D2 dopamine receptor agonist. Also functions as σ1 receptor antagonist with essentially no affinity for the phencylidine site on the NMDA receptor. |
| | R(+)-3-(3-hydroxyphenyl)-N-propylpiperidine hydrochloride Preparation Products And Raw materials |
|