| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-Phenylpiperidine manufacturers
- 3-Phenylpiperidine
-
- $1.00
-
2020-02-17
- CAS:3973-62-4
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons
|
| | 3-Phenylpiperidine Basic information |
| Product Name: | 3-Phenylpiperidine | | Synonyms: | TIMTEC-BB SBB010187;CHEMBRDG-BB 4003675;3-phenylpiperidine(SALTDATA: FREE);(Piperidin-3-yl)benzene;ChemDiv2_003191;EINECS 223-602-7;Piperidine, 3-phenyl-;SBB010187 | | CAS: | 3973-62-4 | | MF: | C11H15N | | MW: | 161.24 | | EINECS: | 223-602-7 | | Product Categories: | Piperidine | | Mol File: | 3973-62-4.mol |  |
| | 3-Phenylpiperidine Chemical Properties |
| Melting point | 142-143℃ | | Boiling point | 121°C/9mm | | density | 0.967 | | refractive index | 1.5256 | | Fp | 116℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 10.01±0.10(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C11H15N/c1-2-5-10(6-3-1)11-7-4-8-12-9-11/h1-3,5-6,11-12H,4,7-9H2 | | InChIKey | NZYBILDYPCVNMU-UHFFFAOYSA-N | | SMILES | N1CCCC(C2=CC=CC=C2)C1 | | CAS DataBase Reference | 3973-62-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 3-Phenylpiperidine Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Synthesis | N-benzyl-3-phenylpiperidine (3-1, 65 g, 258.96 mmol) was added palladium carbon (12 g, 18%), anhydrous ethanol (300 mL) and glacial acetic acid (11 mL) in a reaction flask. The reaction was heated to 60 °C for 12 h under 1 atm hydrogen atmosphere. The reaction progress was monitored by TLC and stopped after confirming the complete reaction of the ingredients. The reaction mixture was filtered to remove palladium carbon and the filtrate was concentrated to dryness by rotary evaporation. The residue was dissolved in water (250 mL) and extracted with ethyl acetate (250 mL x 3), the organic layers were combined and dried over anhydrous sodium sulfate. After filtration, the solvent was removed by rotary evaporation to afford 35.2 g of 3-phenylpiperidine (1) in 89.3% yield, and the product was used directly in the subsequent reaction. | | References | [1] Patent: CN108203404, 2018, A. Location in patent: Paragraph 0223-0226 |
| | 3-Phenylpiperidine Preparation Products And Raw materials |
|