| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
7,8-difluorodibenzo[b,e]thiepin-11(6H)-one manufacturers
|
| | 7,8-difluorodibenzo[b,e]thiepin-11(6H)-one Basic information |
| Product Name: | 7,8-difluorodibenzo[b,e]thiepin-11(6H)-one | | Synonyms: | 7,8-difluoro-Dibenzo[b,e]thiepin-11(6H)-one;Baloxavir Impurity 7;7,8-difluoro-6H-benzo[c][1]benzothiepin-11-one;Dibenzo[b,e]thiepin-11(6H)-one, 7,8-difluoro-;Baloxavir Marboxil Impurity 30;7,8 difluoro dibenzo [B, E] thiopheno-11 (6H) - one;7,8-difluoro-dibenzo [b, e] thiazepine 11 (6H) - one;7 ,8-Difluoro-dibenzo[b,ejthiepin-11(6H)-one | | CAS: | 2136287-66-4 | | MF: | C14H8F2OS | | MW: | 262.27 | | EINECS: | | | Product Categories: | | | Mol File: | 2136287-66-4.mol | ![7,8-difluorodibenzo[b,e]thiepin-11(6H)-one Structure](CAS/20200611/GIF/2136287-66-4.gif) |
| | 7,8-difluorodibenzo[b,e]thiepin-11(6H)-one Chemical Properties |
| Boiling point | 427.7±45.0 °C(Predicted) | | density | 1.393±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C14H8F2OS/c15-11-6-5-8-10(13(11)16)7-18-12-4-2-1-3-9(12)14(8)17/h1-6H,7H2 | | InChIKey | NDIAEKBJODOUBP-UHFFFAOYSA-N | | SMILES | S1CC2=C(F)C(F)=CC=C2C(=O)C2=CC=CC=C12 |
| | 7,8-difluorodibenzo[b,e]thiepin-11(6H)-one Usage And Synthesis |
| Uses | 7,8-difluorodibenzo[b,e]thiepin-11(6H)-one is an important pharmaceutical intermediate for the synthesis of Baloxavir Marboxil fragments. |
| | 7,8-difluorodibenzo[b,e]thiepin-11(6H)-one Preparation Products And Raw materials |
|