|
|
| | L-TYROSINE (3,3-D2) Basic information |
| Product Name: | L-TYROSINE (3,3-D2) | | Synonyms: | L-TYROSINE-BETA BETA-D2;L-TYROSINE (3,3-D2);L-TYROSINE-BETA,BETA-D2, 98 ATOM % D;l-4-hydroxyphenyl(alanine-3,3-d2);(2S)-2-amino-3,3-dideuterio-3-(4-hydroxyphenyl)propanoic acid;L-TYROSINE(3,3-D2) MICROBIOLOGICAL/PYROGEN TESTED;L-Tyrosine-3,3-d2;L-Tyrosine (3,3-D?, 98%) | | CAS: | 72963-27-0 | | MF: | C9H9D2NO3 | | MW: | 183.2 | | EINECS: | | | Product Categories: | Amino Acids 13C, 2H, 15N | | Mol File: | 72963-27-0.mol |  |
| | L-TYROSINE (3,3-D2) Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | Boiling point | 385.163±32.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.334±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at -20°C | | solubility | Aqueous Acid (Slightly) | | form | Solid | | pka | 2.254±0.10(predicted) | | color | White to Off-White | | Optical Rotation | [α]25/D -12.0°, c = 1 in 1 M HCl | | Stability: | Hygroscopic | | InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i5D2 | | InChIKey | OUYCCCASQSFEME-KETSZMSZSA-N | | SMILES | [2H]C([2H])([C@H](N)C(O)=O)c1ccc(O)cc1 | | CAS Number Unlabeled | 60-18-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-TYROSINE (3,3-D2) Usage And Synthesis |
| Uses | L-Tyrosine-d2 is deuterium labelled L-Tyrosine (H899975), which is one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters: dopamine, norepinephrine, and epinephrine. |
| | L-TYROSINE (3,3-D2) Preparation Products And Raw materials |
|