| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | H-[15N]Tyr-OH Basic information |
| | H-[15N]Tyr-OH Chemical Properties |
| Melting point | >300 °C (dec.) (lit.) | | density | 1.334±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -15°C | | solubility | H2O : 11.36 mg/mL (62.36 mM; ultrasonic and warming and adjust pH to 10 with NaOH and heat to 60°C) | | form | Solid | | color | White | | Optical Rotation | [α]25/D -12.0°, c = 1 in 1 M HCl | | InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i10+1 | | InChIKey | OUYCCCASQSFEME-YTRLMEAHSA-N | | SMILES | [15NH2][C@@H](Cc1ccc(O)cc1)C(O)=O | | CAS Number Unlabeled | 60-18-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 28459000 | | Storage Class | 11 - Combustible Solids |
| | H-[15N]Tyr-OH Usage And Synthesis |
| Chemical Properties | Solid | | Uses | L-Tyrosine-15N is labelled analogue of L-Tyrosine (T899975), one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters: dopamine, norepinephrine, and epinephrine. |
| | H-[15N]Tyr-OH Preparation Products And Raw materials |
|