| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
China Langchem Inc. |
| Tel: |
021-58956006,021-58950017 15800617331 |
| Email: |
sales@langchem.com |
p-Terphenyl-d14 manufacturers
|
| | p-Terphenyl-d14 Basic information |
| Product Name: | p-Terphenyl-d14 | | Synonyms: | [2H14]Terphenyl;4-TERPHENYL-D14, 1X1ML, CH2CL2, 2000UG/M L;P-TERPHENYL-D14, 100MG, NEAT;P-TERPHENYL-D14, 98 ATOM % D;p-terphenyl-d14 solution;4-Terphenyl-d14;Terphenyl-d14;1,2,4,5-tetradeuterio-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)benzene | | CAS: | 1718-51-0 | | MF: | C18D14 | | MW: | 244.39 | | EINECS: | 625-035-4 | | Product Categories: | Alphabetical Listings;Stable Isotopes;Alpha Sort;TA - TE;T-ZAlphabetic;Volatiles/ Semivolatiles | | Mol File: | 1718-51-0.mol |  |
| | p-Terphenyl-d14 Chemical Properties |
| Melting point | 212-213 °C(lit.) | | storage temp. | 0-6°C | | solubility | Chloroform (Sparingly), DMSO (Sparingly) | | form | solid | | Major Application | electronics | | InChI | InChI=1S/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D | | InChIKey | XJKSTNDFUHDPQJ-WZAAGXFHSA-N | | SMILES | C1(C2C([2H])=C([2H])C([2H])=C([2H])C=2[2H])C([2H])=C([2H])C(C2C([2H])=C([2H])C([2H])=C([2H])C=2[2H])=C([2H])C=1[2H] | | EPA Substance Registry System | 1,1':4',1''-Terphenyl-2,2',2'',3,3',3'',4,4'',5,5',5'',6,6',6''-d14 (1718-51-0) | | CAS Number Unlabeled | 92-94-4 |
| | p-Terphenyl-d14 Usage And Synthesis |
| Uses | May be used as an analytical standard |
| | p-Terphenyl-d14 Preparation Products And Raw materials |
|