| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:p-Xylene-d4
CAS:16034-43-8
Remarks:CS-C-00616
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:p-Xylene-d4 (ring-d4)
CAS:16034-43-8
Purity:98% Package:5g;25g;100g Remarks:Environmental Standards
|
| Company Name: |
ChengDu SinoStandards Bio-Tech Co.,Ltd. ，
|
| Tel: |
028-83243028 19136088901 |
| Email: |
sinostandards@163.com |
| Products Intro: |
Product Name:p-Xylene-d4 (ring-d4)
CAS:16034-43-8
Purity:标准品 Package:10mg;100mg;1g
|
| Company Name: |
Yancheng Tongming Biotechnology Co., Ltd.
|
| Tel: |
15195160625 |
| Email: |
2863565288@qq.com |
| Products Intro: |
Product Name:p-Xylene-d4 (ring-d4)
CAS:16034-43-8
Purity:98% HPLC Package:0.5 g In Stock
1 g In Stock
|
|
| | P-XYLENE-2,3,5,6-D4 Basic information |
| Product Name: | P-XYLENE-2,3,5,6-D4 | | Synonyms: | 1,4-Dimethyl(benzene-d4);P-XYLENE-2,3,5,6-D4;P-XYLENE-D4;P-XYLENE-D4 (RING-D4);P-XYLENE-2,3,5,6-D4, 98 ATOM % D;1,4-dimethylbenzene-2,3,5,6-d4;p-xylene-d4(phenyl-d4);p-Xylene-(phenyl-d4)
| | CAS: | 16034-43-8 | | MF: | C8H6D4 | | MW: | 110.19 | | EINECS: | | | Product Categories: | | | Mol File: | 16034-43-8.mol |  |
| | P-XYLENE-2,3,5,6-D4 Chemical Properties |
| Melting point | 12-13 °C(lit.) | | Boiling point | 138 °C(lit.) | | density | 0.899 g/mL at 25 °C | | refractive index | n20/D 1.495(lit.) | | Fp | 77 °F | | InChI | 1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i3D,4D,5D,6D | | InChIKey | URLKBWYHVLBVBO-LNFUJOGGSA-N | | SMILES | [2H]c1c([2H])c(C)c([2H])c([2H])c1C |
| Hazard Codes | Xn | | Risk Statements | 10-20/21/22-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1307 3/PG 3 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Aquatic Chronic 3
Asp. Tox. 1
Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | P-XYLENE-2,3,5,6-D4 Usage And Synthesis |
| Uses | p-Xylene-d4 (ring-d4) (CAS# 16034-43-8) is a useful isotopically labeled research compound. |
| | P-XYLENE-2,3,5,6-D4 Preparation Products And Raw materials |
|