| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(2,2-Dimethyl-propionylamino)-nicotinic acid Basic information |
| Product Name: | 2-(2,2-Dimethyl-propionylamino)-nicotinic acid | | Synonyms: | 2-(Pivalamino)nicotinic acid;2-(2,2,2-TRIMETHYLACETAMIDO)NICOTINIC ACID;2-(PIVALOYLAMINO)NICOTINIC ACID;2-[(2,2-DIMETHYLPROPANOYL)AMINO]NICOTINIC ACID;2-pivalamidonicotinic acid;RARECHEM AL BE 1233;2-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylate;3-Pyridinecarboxylic acid, 2-[(2,2-dimethyl-1-oxopropyl)amino]- | | CAS: | 125867-25-6 | | MF: | C11H14N2O3 | | MW: | 222.24 | | EINECS: | | | Product Categories: | | | Mol File: | 125867-25-6.mol |  |
| | 2-(2,2-Dimethyl-propionylamino)-nicotinic acid Chemical Properties |
| Melting point | 235.2-236.7°C | | storage temp. | Store at room temperature | | form | solid | | Appearance | Light yellow to light brown Solid | | InChI | 1S/C11H14N2O3/c1-11(2,3)10(16)13-8-7(9(14)15)5-4-6-12-8/h4-6H,1-3H3,(H,14,15)(H,12,13,16) | | InChIKey | KXLOGMIKCNUSNG-UHFFFAOYSA-N | | SMILES | CC(C)(C)C(=O)Nc1ncccc1C(O)=O |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 2-(2,2-Dimethyl-propionylamino)-nicotinic acid Usage And Synthesis |
| | 2-(2,2-Dimethyl-propionylamino)-nicotinic acid Preparation Products And Raw materials |
|