| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | DL-LEUCINE-1,2-13C2 Basic information |
| | DL-LEUCINE-1,2-13C2 Chemical Properties |
| Melting point | 293-296 °C (subl.)(lit.) | | form | solid | | InChI | 1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/i5+1,6+1 | | InChIKey | ROHFNLRQFUQHCH-MPOCSFTDSA-N | | SMILES | CC(C)C[13CH](N)[13C](O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-LEUCINE-1,2-13C2 Usage And Synthesis |
| Uses | - High-resolution NMR spectroscopy - Metabolomic profiling and pathway analysis - Stable Isotope probing in Environmental microbiology - Pharmaceutical formulation development |
| | DL-LEUCINE-1,2-13C2 Preparation Products And Raw materials |
|