| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Adachibio Inc. |
| Tel: |
+81-8027837258; |
| Email: |
sales@adachibio.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Fmoc-Leu-OH-13C6,15N Basic information |
| Product Name: | Fmoc-Leu-OH-13C6,15N | | Synonyms: | N-(9-FLUORENYLMETHOXYCARBONYL)-L-LEUCINE-13C6,15N;L-LEUCINE-13C6,15N, N-FMOC DERIVATIVE;N-(9-Fluorenylmethoxycarbonyl)-L-Leucine-13C6,15N, L-Leucine-13C6,15N, N-Fmoc;13C and 15N Labeled Fmoc-Leu;L-Leucine-13C6,15N, N-Fmoc;Fmoc-Leu-OH-13C?,1?N;(((9H-Fluoren-9-yl)methoxy)carbonyl)-L-leucine-13C6-15N;Busulfan Impurity 11 | | CAS: | 1163133-36-5 | | MF: | C21H23NO4 | | MW: | 360.47 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Fmoc-Leu-OH-13C6,15N Chemical Properties |
| Melting point | 152-156 °C (lit.) | | form | solid | | Optical Rotation | [α]20/D -25°, c =0.5 in DMF | | Major Application | peptide synthesis | | InChIKey | CBPJQFCAFFNICX-HNIVWWTASA-N | | SMILES | [13CH3][13CH]([13CH3])[13CH2][13C@H]([15NH]C(=O)OCC1c2ccccc2-c3ccccc13)[13C](O)=O | | CAS Number Unlabeled | 35661-60-0 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Leu-OH-13C6,15N Usage And Synthesis |
| Uses | Fmoc-Leu-OH-13C6,15N is a useful reagent in the preparation of heavy isotopic form of the FCAT reagents and its use in labeling of tryptic peptides. |
| | Fmoc-Leu-OH-13C6,15N Preparation Products And Raw materials |
|