| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2-Bromomethyl-1,4-benzodioxane manufacturers
|
| | 2-Bromomethyl-1,4-benzodioxane Basic information |
| Product Name: | 2-Bromomethyl-1,4-benzodioxane | | Synonyms: | 2-BROMOMETHYL-1,4-BENZODIOXAN;2-(BROMOMETHYL)-2,3-DIHYDRO-1,4-BENZODIOXINE;2-(bromomethyl)-2,3-dihydro-1,4-benzodioxin;TIMTEC-BB SBB003290;AKOS 90;2-Bromomethyl-1,4-benzodioxane,97%;2-(broMoMethyl)-3,4-dihydro-2H-chroMene;2-BroMoMethyl-1,4-benzodioxane, 97% 5GR | | CAS: | 2164-34-3 | | MF: | C9H9BrO2 | | MW: | 229.07 | | EINECS: | 218-503-0 | | Product Categories: | Miscellaneous;BenzodioxanesHeterocyclic Building Blocks;Benzodioxanes;Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks | | Mol File: | 2164-34-3.mol |  |
| | 2-Bromomethyl-1,4-benzodioxane Chemical Properties |
| Boiling point | 250-251 °C(lit.) | | density | 1.533 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5720(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | BRN | 150154 | | InChI | InChI=1S/C9H9BrO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6H2 | | InChIKey | QYLFKNVZIFTCIY-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2OCC1CBr | | CAS DataBase Reference | 2164-34-3(CAS DataBase Reference) |
| Hazard Codes | Xi,N | | Risk Statements | 36-51/53 | | Safety Statements | 26-60-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | HS Code | 29329900 | | Storage Class | 12 - Non Combustible Liquids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-Bromomethyl-1,4-benzodioxane Usage And Synthesis |
| Chemical Properties | Clear colorless to greyish or light yellow liquid |
| | 2-Bromomethyl-1,4-benzodioxane Preparation Products And Raw materials |
|